Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
S111521-500g
|
500g |
3
|
$20.90
|
|
| Synonyms | Acetic acid, sodium salt, trihydrate | AKOS015904397 | SODIUM ACETATE [USP-RS] | D01779 | EN300-345872 | 4550K0SC9B | FT-0645115 | SODIUM ACETATE TRIHYDRATE [USP-RS] | sodium acetate. trihydrate | sodium acetatetrihydrate | sodium acetate-trihydrate | SOD |
|---|---|
| Specifications & Purity | GR, ≥99.5% |
| Storage Temp | Desiccated |
| Shipped In | Normal |
| Grade | GR |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Carboxylic acid derivatives |
| Intermediate Tree Nodes | Carboxylic acid salts |
| Direct Parent | Acetate salts |
| Alternative Parents | Monocarboxylic acids and derivatives Carboxylic acids Organic sodium salts Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Acetate salt - Organic alkali metal salt - Monocarboxylic acid or derivatives - Carboxylic acid - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organic sodium salt - Organic salt - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as acetate salts. These are organic compounds containing acetic acid as its acid component. |
| External Descriptors | hydrate |
|
|
|
| IUPAC Name | sodium;acetate;trihydrate |
|---|---|
| INCHI | InChI=1S/C2H4O2.Na.3H2O/c1-2(3)4;;;;/h1H3,(H,3,4);;3*1H2/q;+1;;;/p-1 |
| InChIKey | AYRVGWHSXIMRAB-UHFFFAOYSA-M |
| Smiles | CC(=O)[O-].O.O.O.[Na+] |
| Isomeric SMILES | CC(=O)[O-].O.O.O.[Na+] |
| WGK Germany | 1 |
| RTECS | AJ4580000 |
| PubChem CID | 23665404 |
| Molecular Weight | 136.08 |
| Beilstein | 3732037 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jan 02, 2024 | S111521 | |
| Certificate of Analysis | Jan 02, 2024 | S111521 | |
| Certificate of Analysis | Jan 02, 2024 | S111521 | |
| Certificate of Analysis | Dec 01, 2023 | S111521 | |
| Certificate of Analysis | Apr 15, 2023 | S111521 | |
| Certificate of Analysis | Sep 16, 2022 | S111521 | |
| Certificate of Analysis | Sep 16, 2022 | S111521 | |
| Certificate of Analysis | Sep 16, 2022 | S111521 | |
| Certificate of Analysis | Apr 09, 2022 | S111521 | |
| Certificate of Analysis | Apr 09, 2022 | S111521 |
| Sensitivity | moisture sensitive |
|---|---|
| Melt Point(°C) | 58°C |
| Molecular Weight | 136.080 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 0 |
| Exact Mass | 136.035 Da |
| Monoisotopic Mass | 136.035 Da |
| Topological Polar Surface Area | 43.100 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 34.600 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 5 |