Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
I167946-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$99.90
|
|
|
I167946-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$199.90
|
|
|
I167946-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$629.90
|
|
| Synonyms | 1-propan-2-ylpyrrolidine | AKOS005174153 | 1-isopropylpyrrolidine | N-Isopropylpyrrolidine, 97% | InChI=1/C7H15N/c1-7(2)8-5-3-4-6-8/h7H,3-6H2,1-2H | DTXSID50497264 | isopropylpyrrolidine | YQOPNAOQGQSUHF-UHFFFAOYSA-N | 1-(Propan-2-yl)pyrrolidine | J-01111 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature,Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrrolidines |
| Subclass | N-alkylpyrrolidines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | N-alkylpyrrolidines |
| Alternative Parents | Trialkylamines Azacyclic compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | N-alkylpyrrolidine - Tertiary aliphatic amine - Tertiary amine - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Amine - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as n-alkylpyrrolidines. These are compounds containing a pyrrolidine moiety that is substituted at the N1-position with an alkyl group. Pyrrolidine is a five-membered saturated aliphatic heterocycle with one nitrogen atom and four carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-propan-2-ylpyrrolidine |
|---|---|
| INCHI | InChI=1S/C7H15N/c1-7(2)8-5-3-4-6-8/h7H,3-6H2,1-2H3 |
| InChIKey | YQOPNAOQGQSUHF-UHFFFAOYSA-N |
| Smiles | CC(C)N1CCCC1 |
| Isomeric SMILES | CC(C)N1CCCC1 |
| WGK Germany | 3 |
| Molecular Weight | 113.20 |
| Reaxy-Rn | 1340536 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1340536&ln= |
| Refractive Index | 1.438 |
|---|---|
| Flash Point(°F) | 64.4 °F |
| Flash Point(°C) | 18 °C |
| Molecular Weight | 113.200 g/mol |
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 113.12 Da |
| Monoisotopic Mass | 113.12 Da |
| Topological Polar Surface Area | 3.200 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 62.800 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Starting at $536.90
Starting at $266.90
Starting at $50.90
Starting at $183.90
Starting at $689.90