Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
I185097-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$536.90
|
|
|
I185097-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,367.90
|
|
Discover 2-Isopropylpyrrolidine, HCl by Aladdin Scientific in 95% for only $536.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-Isopropylpyrrolidine hydrochloride | 540526-01-0 | 2-ISOPROPYLPYRROLIDINE HCL | 2-propan-2-ylpyrrolidine;hydrochloride | 2-(Propan-2-Yl)Pyrrolidine Hydrochloride | 2-Isopropylpyrrolidinehydrochloride | 2-ISOPROPYLPYRROLIDINE, HCL | MFCD29037443 | MFCD29037444 | SCHEMBL13 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrrolidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrrolidines |
| Alternative Parents | Dialkylamines Azacyclic compounds Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Pyrrolidine - Azacycle - Secondary amine - Secondary aliphatic amine - Organic nitrogen compound - Hydrocarbon derivative - Hydrochloride - Organonitrogen compound - Amine - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrrolidines. These are compounds containing a pyrrolidine ring, which is a five-membered saturated aliphatic heterocycle with one nitrogen atom and four carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-propan-2-ylpyrrolidine;hydrochloride |
|---|---|
| INCHI | InChI=1S/C7H15N.ClH/c1-6(2)7-4-3-5-8-7;/h6-8H,3-5H2,1-2H3;1H |
| InChIKey | CDMWOCOXYGUROI-UHFFFAOYSA-N |
| Smiles | CC(C)C1CCCN1.Cl |
| Isomeric SMILES | CC(C)C1CCCN1.Cl |
| Molecular Weight | 149.7 |
| Reaxy-Rn | 20474407 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=20474407&ln= |
| Molecular Weight | 149.660 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 149.097 Da |
| Monoisotopic Mass | 149.097 Da |
| Topological Polar Surface Area | 12.000 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 68.800 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |