Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E114210-1ml
|
1ml |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$62.90
|
|
| Synonyms | BETA-ENDOSULFAN | Endosulfan I, vial of 1 g, (alpha isomer), 99%, analytical standard | n'-hydroxypyridine-3-carboxamidine | CCRIS 1461 | Endosulfan B | BIDD:PXR0005 | Endosulfan 2 | NCGC00255451-01 | SRNDYVBEUZSFEZ-RMKNXTFCSA-N | ALPHA-ENDOSULFAN | b-End |
|---|---|
| Specifications & Purity | analytical standard, 100ug/ml,u=3% in benzene |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
| Grade | analytical standard |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organic oxoanionic compounds |
| Subclass | Organic sulfites |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Sulfite esters |
| Alternative Parents | Vinyl chlorides Oxacyclic compounds Chloroalkenes Organooxygen compounds Organochlorides Organic oxides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Sulfite ester - Oxacycle - Chloroalkene - Haloalkene - Organoheterocyclic compound - Vinyl halide - Vinyl chloride - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organochloride - Organohalogen compound - Alkyl halide - Alkyl chloride - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as sulfite esters. These are organic compounds containing an organic group attached to the sulfite oxoanion, with the formula R[SO3]2-. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (1R,2S,8R,9S)-1,9,10,11,12,12-hexachloro-4,6-dioxa-5λ4-thiatricyclo[7.2.1.02,8]dodec-10-ene 5-oxide |
|---|---|
| INCHI | InChI=1S/C9H6Cl6O3S/c10-5-6(11)8(13)4-2-18-19(16)17-1-3(4)7(5,12)9(8,14)15/h3-4H,1-2H2/t3-,4+,7-,8+,19? |
| InChIKey | RDYMFSUJUZBWLH-AZVNHNRSSA-N |
| Smiles | C1C2C(COS(=O)O1)C3(C(=C(C2(C3(Cl)Cl)Cl)Cl)Cl)Cl |
| Isomeric SMILES | C1[C@@H]2[C@H](COS(=O)O1)[C@@]3(C(=C([C@]2(C3(Cl)Cl)Cl)Cl)Cl)Cl |
| WGK Germany | 2 |
| UN Number | 2761 |
| Packing Group | I |
| Molecular Weight | 406.93 |
| Beilstein | 2950316 |
| Reaxy-Rn | 1262315 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1262315&ln= |
| Sensitivity | light sensitive |
|---|---|
| Flash Point(°F) | -14.8 °F |
| Flash Point(°C) | -26 °C |
| Molecular Weight | 406.900 g/mol |
| XLogP3 | 3.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 405.814 Da |
| Monoisotopic Mass | 403.817 Da |
| Topological Polar Surface Area | 54.700 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 470.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |