Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
W417098-5mg
|
5mg |
3
|
$309.90
|
|
|
W417098-25mg
|
25mg |
3
|
$1,133.90
|
|
|
W417098-50mg
|
50mg |
3
|
$2,060.90
|
|
|
W417098-100mg
|
100mg |
3
|
$3,434.90
|
|
| Synonyms | 5-((4-Chlorophenoxy)methyl)-N-(2-fluorophenyl)furan-2-carboxamide5-((4-Chlorophenoxy)methyl)-N-(2-fluorophenyl)furan-2-carboxamide |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at -20°C |
| Shipped In |
Ice chest + Ice pads This product requires cold chain shipping. Ground and other economy services are not available. |
| Product Description |
high inhibition rate against osteoclast formation |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Anilides |
| Intermediate Tree Nodes | Aromatic anilides - Furanilides |
| Direct Parent | 2-furanilides |
| Alternative Parents | Phenoxy compounds Phenol ethers 2-heteroaryl carboxamides Furoic acid and derivatives Alkyl aryl ethers Chlorobenzenes Fluorobenzenes Aryl chlorides Aryl fluorides Heteroaromatic compounds Secondary carboxylic acid amides Oxacyclic compounds Hydrocarbon derivatives Organic oxides Organochlorides Organofluorides Organonitrogen compounds Organopnictogen compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2-furanilide - 2-heteroaryl carboxamide - Furoic acid or derivatives - Phenoxy compound - Phenol ether - Alkyl aryl ether - Halobenzene - Fluorobenzene - Chlorobenzene - Aryl chloride - Aryl fluoride - Aryl halide - Furan - Heteroaromatic compound - Carboxamide group - Secondary carboxylic acid amide - Carboxylic acid derivative - Oxacycle - Ether - Organoheterocyclic compound - Organic nitrogen compound - Organohalogen compound - Organochloride - Organofluoride - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 2-furanilides. These are aromatic heterocyclic compounds contaning a furan ring that is substituted at the 2-position with an anilide. |
| External Descriptors | Not available |
|
|
|
| ALogP | 4.524 |
|---|---|
| HBD Count | 1 |
| Rotatable Bond | 5 |
| Pubchem Sid | 504759969 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504759969 |
| IUPAC Name | 5-[(4-chlorophenoxy)methyl]-N-(2-fluorophenyl)furan-2-carboxamide |
| INCHI | InChI=1S/C18H13ClFNO3/c19-12-5-7-13(8-6-12)23-11-14-9-10-17(24-14)18(22)21-16-4-2-1-3-15(16)20/h1-10H,11H2,(H,21,22) |
| InChIKey | WWOCPTXYPHWAJY-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C(=C1)NC(=O)C2=CC=C(O2)COC3=CC=C(C=C3)Cl)F |
| Isomeric SMILES | C1=CC=C(C(=C1)NC(=O)C2=CC=C(O2)COC3=CC=C(C=C3)Cl)F |
| PubChem CID | 717221 |
| Molecular Weight | 345.75 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jul 09, 2025 | W417098 | |
| Certificate of Analysis | Jul 09, 2025 | W417098 | |
| Certificate of Analysis | Jul 09, 2025 | W417098 | |
| Certificate of Analysis | Jul 09, 2025 | W417098 | |
| Certificate of Analysis | Jul 19, 2022 | W417098 |
| DMSO(mM) Max Solubility | 10 |
|---|---|
| Molecular Weight | 345.700 g/mol |
| XLogP3 | 4.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Exact Mass | 345.057 Da |
| Monoisotopic Mass | 345.057 Da |
| Topological Polar Surface Area | 51.500 Ų |
| Heavy Atom Count | 24 |
| Formal Charge | 0 |
| Complexity | 417.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |