Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T134802-100mg
|
100mg |
2
|
$109.90
|
|
| Synonyms | TCPP | tris(1-chloropropan-2-yl) phosphate | NCGC00257407-01 | MFCD00040408 | J50.405J | CS-0059312 | TRIS(.BETA.-CHLOROISOPROPYL) PHOSPHATE | TRIS(2-CHLOROISOPROPYL)PHOSPHATE | Q2454095 | Tris(1-chloro-2-propanyl) phosphate | NCGC00260528-01 | 2-Propanol |
|---|---|
| Specifications & Purity | analytical standard |
| Shipped In | Normal |
| Grade | analytical standard |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Organic phosphoric acids and derivatives |
| Subclass | Phosphate esters |
| Intermediate Tree Nodes | Alkyl phosphates |
| Direct Parent | Trialkyl phosphates |
| Alternative Parents | Organooxygen compounds Organochlorides Organic oxides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Trialkyl phosphate - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organochloride - Organohalogen compound - Alkyl halide - Alkyl chloride - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as trialkyl phosphates. These are organic compounds containing a phosphate group that is linked to exactly three alkyl chains. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tris(1-chloropropan-2-yl) phosphate |
|---|---|
| INCHI | InChI=1S/C9H18Cl3O4P/c1-7(4-10)14-17(13,15-8(2)5-11)16-9(3)6-12/h7-9H,4-6H2,1-3H3 |
| InChIKey | KVMPUXDNESXNOH-UHFFFAOYSA-N |
| Smiles | CC(CCl)OP(=O)(OC(C)CCl)OC(C)CCl |
| Isomeric SMILES | CC(CCl)OP(=O)(OC(C)CCl)OC(C)CCl |
| RTECS | TC9000000 |
| Molecular Weight | 327.57 |
| Beilstein | 1842347 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Apr 02, 2024 | T134802 |
| Flash Point(°C) | 218-220°C |
|---|---|
| Molecular Weight | 327.600 g/mol |
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 9 |
| Exact Mass | 326.001 Da |
| Monoisotopic Mass | 326.001 Da |
| Topological Polar Surface Area | 44.800 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 216.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 3 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |