Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T396141-1g
|
1g |
3
|
$158.90
|
|
| Synonyms | Triphenylen-2-ylboronic acid | 654664-63-8 | 2-triphenylenylBoronic acid | B-2-Triphenylenylboronic acid | Triphenylene-2-boronic acid | MFCD16660186 | Triphenylen-2-ylboronic | 2-Triphenyleneboronic Acid | Triphenylen-2-ylboronicacid | 2-triphenylene boronic acid | tripheny |
|---|---|
| Specifications & Purity | ≥99% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenanthrenes and derivatives |
| Subclass | Triphenylenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Triphenylenes |
| Alternative Parents | Naphthalenes Boronic acids Organic metalloid salts Organometalloid compounds Organic oxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Triphenylene - Naphthalene - Boronic acid - Boronic acid derivative - Organic metalloid salt - Organic oxygen compound - Hydrocarbon derivative - Organic metalloid moeity - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as triphenylenes. These are compounds containing a triphenylene moiety, which consists of four fused benzene rings forming a 9,10-benzo[l]phenanthrene. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504771772 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504771772 |
| IUPAC Name | triphenylen-2-ylboronic acid |
| INCHI | InChI=1S/C18H13BO2/c20-19(21)12-9-10-17-15-7-2-1-5-13(15)14-6-3-4-8-16(14)18(17)11-12/h1-11,20-21H |
| InChIKey | PXFBSZZEOWJJNL-UHFFFAOYSA-N |
| Smiles | B(C1=CC2=C(C=C1)C3=CC=CC=C3C4=CC=CC=C42)(O)O |
| Isomeric SMILES | B(C1=CC2=C(C=C1)C3=CC=CC=C3C4=CC=CC=C42)(O)O |
| PubChem CID | 59805119 |
| Molecular Weight | 272.11 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Nov 09, 2022 | T396141 |
| Molecular Weight | 272.100 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 272.101 Da |
| Monoisotopic Mass | 272.101 Da |
| Topological Polar Surface Area | 40.500 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 372.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |