Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T473799-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,586.90
|
|
| Synonyms | 13C Labeled triethyl phosphonoacetate | Triethyl phosphonoacetate-13C2 | AKOS015915629 | HY-Y0677S | Triethyl phosphonoacetate-13C2, 99 atom % 13C | Triethyl phosphonoacetate-13c2,99 atom % 13c | Carbethoxymethyldiethyl phosphonate-C13 | Acetic-13C2 acid, |
|---|---|
| Specifications & Purity | ≥99 atom% 13C |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Organic phosphonic acids and derivatives |
| Subclass | Phosphonic acid diesters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dialkyl alkylphosphonates |
| Alternative Parents | Phosphonic acid esters Carboxylic acid esters Monocarboxylic acids and derivatives Organophosphorus compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Dialkyl alkylphosphonate - Phosphonic acid ester - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organophosphorus compound - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as dialkyl alkylphosphonates. These are compounds containing a phosphonic acid that is diesterified with alkyl groups, and the phosphorus atom is also directly attached to an alkyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | ethyl 2-diethoxyphosphorylacetate |
|---|---|
| INCHI | InChI=1S/C8H17O5P/c1-4-11-8(9)7-14(10,12-5-2)13-6-3/h4-7H2,1-3H3/i7+1,8+1 |
| InChIKey | GGUBFICZYGKNTD-BFGUONQLSA-N |
| Smiles | CCOC(=O)CP(=O)(OCC)OCC |
| Isomeric SMILES | CCO[13C](=O)[13CH2]P(=O)(OCC)OCC |
| WGK Germany | 3 |
| Molecular Weight | 226.18 |
| Reaxy-Rn | 5338716 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=5338716&ln= |
| Flash Point(°F) | 235.4 °F |
|---|---|
| Flash Point(°C) | 113 °C |
| Boil Point(°C) | 142-145° C (lit.) at 9 mmHg |
| Molecular Weight | 226.180 g/mol |
| XLogP3 | 0.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 8 |
| Exact Mass | 226.088 Da |
| Monoisotopic Mass | 226.088 Da |
| Topological Polar Surface Area | 61.800 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 206.000 |
| Isotope Atom Count | 2 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |