Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T140809-500ml
|
500ml |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$22.90
|
|
| Synonyms | Methyltriacetoxysilane | 4253-34-3 | Triacetoxy(methyl)silane | Triacetoxymethylsilane | Methylsilanetriyl triacetate | Silanetriol, methyl-, triacetate | Methylsilanetriol triacetate | Silane, methyltriacetoxy- | Methyltrihydroxysilane triacetate | [diacetyloxy(methyl)sil |
|---|---|
| Specifications & Purity | ≥55%(GC) |
| Storage Temp | Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Tricarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Tricarboxylic acids and derivatives |
| Alternative Parents | Trialkoxysilanes Acetate salts Organoheterosilanes Organic metalloid salts Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Tricarboxylic acid or derivatives - Trialkoxysilane - Acetate salt - Alkoxysilane - Carboxylic acid salt - Organoheterosilane - Organic metalloid salt - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organic salt - Organosilicon compound - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as tricarboxylic acids and derivatives. These are carboxylic acids containing exactly three carboxyl groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | [diacetyloxy(methyl)silyl] acetate |
|---|---|
| INCHI | InChI=1S/C7H12O6Si/c1-5(8)11-14(4,12-6(2)9)13-7(3)10/h1-4H3 |
| InChIKey | TVJPBVNWVPUZBM-UHFFFAOYSA-N |
| Smiles | CC(=O)O[Si](C)(OC(=O)C)OC(=O)C |
| Isomeric SMILES | CC(=O)O[Si](C)(OC(=O)C)OC(=O)C |
| PubChem CID | 77929 |
| Molecular Weight | 220.25 |
| Beilstein | 1788668 |
| Sensitivity | Moisture sensitive |
|---|---|
| Freezing Point(°C) | 40 °C |
| Refractive Index | 1.4045-1.4055 |
| Flash Point(°F) | 185°F |
| Flash Point(°C) | >80℃ |
| Boil Point(°C) | 94-95 °C |
| Melt Point(°C) | 40-45°C |
| Molecular Weight | 220.250 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 6 |
| Exact Mass | 220.04 Da |
| Monoisotopic Mass | 220.04 Da |
| Topological Polar Surface Area | 78.900 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 220.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |