Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
I169016-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$408.90
|
|
| Synonyms | 24948-05-8 | trans-2-(Aminomethyl)cyclohexanol hydrochloride | (1R,2S)-2-(AMINOMETHYL)CYCLOHEXAN-1-OL HYDROCHLORIDE | 375819-19-5 | (1R,2S)-2-(aminomethyl)cyclohexan-1-ol;hydrochloride | Cyclohexanol, 2-(aminomethyl)-, hydrochloride, trans- (8CI) | TRANS-2-AMINOMETHY |
|---|---|
| Specifications & Purity | ≥96.5%(GC) |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Alcohols and polyols |
| Intermediate Tree Nodes | Secondary alcohols |
| Direct Parent | Cyclohexanols |
| Alternative Parents | Cyclic alcohols and derivatives Organopnictogen compounds Monoalkylamines Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Cyclohexanol - Cyclic alcohol - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Hydrochloride - Primary amine - Organonitrogen compound - Primary aliphatic amine - Amine - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as cyclohexanols. These are compounds containing an alcohol group attached to a cyclohexane ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (1R,2S)-2-(aminomethyl)cyclohexan-1-ol;hydrochloride |
|---|---|
| INCHI | InChI=1S/C7H15NO.ClH/c8-5-6-3-1-2-4-7(6)9;/h6-7,9H,1-5,8H2;1H/t6-,7+;/m0./s1 |
| InChIKey | UVYXWKUCIQHOCP-UOERWJHTSA-N |
| Smiles | C1CCC(C(C1)CN)O.Cl |
| Molecular Weight | 165.660 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 165.092 Da |
| Monoisotopic Mass | 165.092 Da |
| Topological Polar Surface Area | 46.300 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 85.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |