Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T388600-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$324.90
|
|
| Synonyms | AC-6415 | AMY20589 | Thiomorpholine-2,4-dicarboxylic acid 4-tert-butylester | AS-54695 | SCHEMBL160579 | Thiomorpholine-2,4-dicarboxylic acid 4-tert-butyl ester | VJGKMSGPYQNGGK-UHFFFAOYSA-N | Q-102498 | CS-0097843 | N-Boc-2-thiomorpholinecarboxylic Acid |
|---|---|
| Specifications & Purity | ≥97% |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Thiazinanes |
| Subclass | Thiomorpholines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Thiomorpholine carboxylic acids and derivatives |
| Alternative Parents | Carbamate esters Organic carbonic acids and derivatives Monocarboxylic acids and derivatives Dialkylthioethers Carboxylic acids Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Thiomorpholine-4-carboxylic acid - Thiomorpholine-2-carboxylic acid - Carbamic acid ester - Carbonic acid derivative - Carboxylic acid derivative - Carboxylic acid - Monocarboxylic acid or derivatives - Thioether - Dialkylthioether - Azacycle - Carbonyl group - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Organic nitrogen compound - Hydrocarbon derivative - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as thiomorpholine carboxylic acids and derivatives. These are heterocyclic compounds containing a thiomorpholine ring substituted by one or more carboxylic acid groups (or derivative thereof). Thiomorpholine a six-membered aliphatic ring containing one nitrogen atom and one sulfur atom at positions 1 and 4 respectively, and four carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxycarbonyl]thiomorpholine-2-carboxylic acid |
|---|---|
| INCHI | InChI=1S/C10H17NO4S/c1-10(2,3)15-9(14)11-4-5-16-7(6-11)8(12)13/h7H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | VJGKMSGPYQNGGK-UHFFFAOYSA-N |
| Smiles | CC(C)(C)OC(=O)N1CCSC(C1)C(=O)O |
| Isomeric SMILES | CC(C)(C)OC(=O)N1CCSC(C1)C(=O)O |
| Alternate CAS | 134676-67-8 |
| PubChem CID | 2760619 |
| Molecular Weight | 247.31 |
| Molecular Weight | 247.310 g/mol |
|---|---|
| XLogP3 | 1.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 247.088 Da |
| Monoisotopic Mass | 247.088 Da |
| Topological Polar Surface Area | 92.100 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 287.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |