Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T162211-5g
|
5g |
1
|
$95.90
|
|
| Synonyms | SY111234 | 4-methylbenzenesulfonate;tetramethylazanium | tetramethylammonium tosylate | tetramethylammonium 4-methylbenzenesulfonate | D85922 | CS-0153046 | SCHEMBL216795 | Tetramethylammonium toluene-p-sulphonate | AKOS015840445 | MFCD00043173 | tetramet |
|---|---|
| Specifications & Purity | ≥99%(T) |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzenesulfonic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | p-Methylbenzenesulfonates |
| Alternative Parents | Tosyl compounds Benzenesulfonyl compounds 1-sulfo,2-unsubstituted aromatic compounds Tetraalkylammonium salts Sulfonyls Organosulfonic acids Organic oxides Hydrocarbon derivatives Amines Organic cations |
| Molecular Framework | Not available |
| Substituents | P-methylbenzenesulfonate - Tosyl compound - Arylsulfonic acid or derivatives - 1-sulfo,2-unsubstituted aromatic compound - Benzenesulfonyl group - Toluene - Quaternary ammonium salt - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Organosulfonic acid - Sulfonyl - Tetraalkylammonium salt - Organonitrogen compound - Organic nitrogen compound - Organosulfur compound - Organic oxygen compound - Organic oxide - Amine - Hydrocarbon derivative - Organic cation - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as p-methylbenzenesulfonates. These are benzenesulfonic acids (or derivative thereof) carrying a methyl group at the para- position. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504764221 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504764221 |
| IUPAC Name | 4-methylbenzenesulfonate;tetramethylazanium |
| INCHI | InChI=1S/C7H8O3S.C4H12N/c1-6-2-4-7(5-3-6)11(8,9)10;1-5(2,3)4/h2-5H,1H3,(H,8,9,10);1-4H3/q;+1/p-1 |
| InChIKey | FHVCZJGBXWNGIZ-UHFFFAOYSA-M |
| Smiles | CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+](C)(C)C |
| Isomeric SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+](C)(C)C |
| PubChem CID | 6451622 |
| Molecular Weight | 245.34 |
| Reaxy-Rn | 5195510 |
| Molecular Weight | 245.340 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 245.109 Da |
| Monoisotopic Mass | 245.109 Da |
| Topological Polar Surface Area | 65.600 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 212.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
Starting at $9.90