Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T432630-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,761.90
|
|
| Synonyms | Ti(NMe2)4 | ?TETRAKIS(DIMETHYLAMINO)TITANIUM | TDMAT | Tetrakis(dimethylamino)titanium(IV) | Tetrakis(dimethylamido)titanium(IV), technical grade, >=80% | D92585 | NSC130237 | NSC-130237 | Tetrakis(dimethylamido)titanium(IV), 99.999% trace metals basis | |
|---|---|
| Specifications & Purity | packaged for use in deposition systems |
| Product Description |
General Description Atomic number of base material: 22 Titanium Application Precursors Packaged for Depositions Systems |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic salts |
| Class | Organic metal salts |
| Subclass | Organic transition metal salts |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organic transition metal salts |
| Alternative Parents | Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Not available |
| Substituents | Organic transition metal salt - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as organic transition metal salts. These are organic salt compounds containing a transition metal atom in its ionic form. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | dimethylazanide;titanium(4+) |
|---|---|
| INCHI | InChI=1S/4C2H6N.Ti/c4*1-3-2;/h4*1-2H3;/q4*-1;+4 |
| InChIKey | MNWRORMXBIWXCI-UHFFFAOYSA-N |
| Smiles | CN(C)[Ti](N(C)C)(N(C)C)N(C)C |
| Isomeric SMILES | C[N-]C.C[N-]C.C[N-]C.C[N-]C.[Ti+4] |
| WGK Germany | 3 |
| PubChem CID | 123185 |
| NSC Number | 130237 |
| Molecular Weight | 224.18 |
| Refractive Index | 1.55 |
|---|---|
| Flash Point(°C) | -30°C(lit.) |
| Boil Point(°C) | 50 °C |
| Melt Point(°C) | <4°C |
| Molecular Weight | 224.170 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 224.148 Da |
| Monoisotopic Mass | 224.148 Da |
| Topological Polar Surface Area | 4.000 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 24.100 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 5 |