Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T770205-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$43.90
|
|
|
T770205-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$117.90
|
|
| Specifications & Purity | ≥99% |
|---|---|
| Storage Temp | Room temperature,Desiccated |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Sesquiterpenoids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Sesquiterpenoids |
| Alternative Parents | Stilbenes Diphenylmethanes Toluenes Aromatic hydrocarbons Branched unsaturated hydrocarbons Cyclic olefins |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Bisabolane sesquiterpenoid - Sesquiterpenoid - Stilbene - Diphenylmethane - Toluene - Benzenoid - Monocyclic benzene moiety - Aromatic hydrocarbon - Branched unsaturated hydrocarbon - Cyclic olefin - Unsaturated hydrocarbon - Olefin - Hydrocarbon - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as sesquiterpenoids. These are terpenes with three consecutive isoprene units. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-methyl-4-[1,2,2-tris(4-methylphenyl)ethenyl]benzene |
|---|---|
| INCHI | InChI=1S/C30H28/c1-21-5-13-25(14-6-21)29(26-15-7-22(2)8-16-26)30(27-17-9-23(3)10-18-27)28-19-11-24(4)12-20-28/h5-20H,1-4H3 |
| InChIKey | KNBCWMJBIJTDTC-UHFFFAOYSA-N |
| Smiles | CC1=CC=C(C=C1)C(=C(C2=CC=C(C=C2)C)C3=CC=C(C=C3)C)C4=CC=C(C=C4)C |
| Isomeric SMILES | CC1=CC=C(C=C1)C(=C(C2=CC=C(C=C2)C)C3=CC=C(C=C3)C)C4=CC=C(C=C4)C |
| PubChem CID | 138601 |
| Molecular Weight | 388.5 |
| Molecular Weight | 388.500 g/mol |
|---|---|
| XLogP3 | 9.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 4 |
| Exact Mass | 388.219 Da |
| Monoisotopic Mass | 388.219 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 30 |
| Formal Charge | 0 |
| Complexity | 441.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |