Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T175086-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,818.90
|
|
| Synonyms | 1788044-12-1 | tert-Butyl 1-azaspiro[3.3]heptan-6-ylcarbamate hydrochloride | 2306253-30-3 | cis-6-(boc-amino)-1-azaspiro[3.3]heptane hydrochloride | tert-Butyl 1-azaspiro[3.3]heptan-6-ylcarbamate HCl | TERT-BUTYL N-{1-AZASPIRO[3.3]HEPTAN-6-YL}CARBAMATE HYDROCHLORI |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Carbamic acids and derivatives |
| Direct Parent | Carbamate esters |
| Alternative Parents | Azetidines Dialkylamines Azacyclic compounds Organic oxides Hydrochlorides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Carbamic acid ester - Azetidine - Secondary aliphatic amine - Secondary amine - Organoheterocyclic compound - Azacycle - Organic nitrogen compound - Organic oxygen compound - Amine - Organooxygen compound - Organonitrogen compound - Hydrochloride - Carbonyl group - Hydrocarbon derivative - Organic oxide - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as carbamate esters. These are compounds containing an ester of carbamic acid with the general structure R2NC(=O)OR' (R' not H). They are esters of carbamic acids. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tert-butyl N-(1-azaspiro[3.3]heptan-6-yl)carbamate;hydrochloride |
|---|---|
| INCHI | InChI=1S/C11H20N2O2.ClH/c1-10(2,3)15-9(14)13-8-6-11(7-8)4-5-12-11;/h8,12H,4-7H2,1-3H3,(H,13,14);1H |
| InChIKey | NOTAIHJBPKQTMR-UHFFFAOYSA-N |
| Smiles | CC(C)(C)OC(=O)NC1CC2(C1)CCN2.Cl |
| Molecular Weight | 248.750 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 248.129 Da |
| Monoisotopic Mass | 248.129 Da |
| Topological Polar Surface Area | 50.400 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 264.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |