Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T174224-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$15,760.90
|
|
| Synonyms | 1434142-21-8 | tert-Butyl 7-formyl-2-azaspiro[3.5]nonane-2-carboxylate | 2-BOC-2-AZASPIRO[3.5]NONANE-7-CARBALDEHYDE | MFCD27956904 | tert-butyl7-formyl-2-azaspiro[3.5]nonane-2-carboxylate | DTXSID301142412 | AKOS027252074 | SB11062 | 2-Boc-7-formyl-2-azaspiro[3.5]nonane | |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azetidines |
| Subclass | Azetidinecarboxylic acids or derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Azetidinecarboxylic acids |
| Alternative Parents | Carbamate esters Organic carbonic acids and derivatives Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Aldehydes |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Azetidinecarboxylic acid - Carbamic acid ester - Carbonic acid derivative - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aldehyde - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as azetidinecarboxylic acids. These are organic compounds containing a carboxylic acid group attached to an azetidine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tert-butyl 7-formyl-2-azaspiro[3.5]nonane-2-carboxylate |
|---|---|
| INCHI | InChI=1S/C14H23NO3/c1-13(2,3)18-12(17)15-9-14(10-15)6-4-11(8-16)5-7-14/h8,11H,4-7,9-10H2,1-3H3 |
| InChIKey | DENTZXANSHPNOQ-UHFFFAOYSA-N |
| Smiles | CC(C)(C)OC(=O)N1CC2(C1)CCC(CC2)C=O |
| Molecular Weight | 253.340 g/mol |
|---|---|
| XLogP3 | 1.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 253.168 Da |
| Monoisotopic Mass | 253.168 Da |
| Topological Polar Surface Area | 46.600 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 329.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |