Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T176351-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$254.90
|
|
Discover tert-butyl 4-hydroxy-4-(hydroxymethyl)piperidine-1-carboxylate by Aladdin Scientific in 97% for only $254.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 389889-80-9 | tert-Butyl 4-hydroxy-4-(hydroxymethyl)piperidine-1-carboxylate | 1-Boc-4-hydroxy-4-(hydroxymethyl)-piperidine | 1-boc-4-hydroxy-4-(hydroxymethyl)piperidine | MFCD08062514 | 1-Boc-4-(hydroxymethyl)piperidin-4-ol | SCHEMBL2349423 | DTXSID70626711 | BKZFMSPPZX |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Piperidinecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidinecarboxylic acids |
| Alternative Parents | Tertiary alcohols Carbamate esters 1,2-diols Azacyclic compounds Primary alcohols Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Piperidinecarboxylic acid - Carbamic acid ester - Tertiary alcohol - 1,2-diol - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Organonitrogen compound - Carbonyl group - Alcohol - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidinecarboxylic acids. These are compounds containing a piperidine ring which bears a carboxylic acid group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tert-butyl 4-hydroxy-4-(hydroxymethyl)piperidine-1-carboxylate |
|---|---|
| INCHI | InChI=1S/C11H21NO4/c1-10(2,3)16-9(14)12-6-4-11(15,8-13)5-7-12/h13,15H,4-8H2,1-3H3 |
| InChIKey | BKZFMSPPZXDTJL-UHFFFAOYSA-N |
| Smiles | CC(C)(C)OC(=O)N1CCC(CC1)(CO)O |
| Molecular Weight | 231.290 g/mol |
|---|---|
| XLogP3 | 0.100 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 231.147 Da |
| Monoisotopic Mass | 231.147 Da |
| Topological Polar Surface Area | 70.000 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 251.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |