Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T637401-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$293.90
|
|
| Synonyms | 1,1-Dimethylethyl 4-(difluoromethyl)-1-piperidinecarboxylate | AS-83419 | 1093759-68-2 | UZTUVAKJCZJUJS-UHFFFAOYSA-N | 1-Boc-4-(difluoromethyl)piperidine | SCHEMBL2706672 | 1-BOC-4-DIFLUOROMETHYLPIPERIDINE | 1-N-Boc-4-difluoromethylpiperidine | AKOS025403 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Piperidinecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidinecarboxylic acids |
| Alternative Parents | Carbamate esters Tertiary amines Azacyclic compounds Organofluorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl fluorides |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Piperidinecarboxylic acid - Carbamic acid ester - Tertiary amine - Azacycle - Alkyl fluoride - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Carbonyl group - Amine - Alkyl halide - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidinecarboxylic acids. These are compounds containing a piperidine ring which bears a carboxylic acid group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tert-butyl 4-(difluoromethyl)piperidine-1-carboxylate |
|---|---|
| INCHI | InChI=1S/C11H19F2NO2/c1-11(2,3)16-10(15)14-6-4-8(5-7-14)9(12)13/h8-9H,4-7H2,1-3H3 |
| InChIKey | UZTUVAKJCZJUJS-UHFFFAOYSA-N |
| Smiles | CC(C)(C)OC(=O)N1CCC(CC1)C(F)F |
| Isomeric SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(F)F |
| Alternate CAS | 1093759-68-2 |
| PubChem CID | 49759148 |
| Molecular Weight | 235.28 |
| Molecular Weight | 235.270 g/mol |
|---|---|
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 235.138 Da |
| Monoisotopic Mass | 235.138 Da |
| Topological Polar Surface Area | 29.500 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 243.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |