Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T638400-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$777.90
|
|
| Synonyms | tert-butyl 4-(aminomethyl)-4-methoxypiperidine-1-carboxylate | ZIYOADOXUKBYLJ-UHFFFAOYSA-N | MFCD11845432 | 1-Piperidinecarboxylic acid,4-(aminomethyl)-4-methoxy-,1,1-dimethylethyl ester | SY013365 | CS-0091213 | FT-0735602 | 1-Piperidinecarboxylic acid, |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Piperidinecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidinecarboxylic acids |
| Alternative Parents | Carbamate esters Dialkyl ethers Azacyclic compounds Organopnictogen compounds Organic oxides Monoalkylamines Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Piperidinecarboxylic acid - Carbamic acid ester - Dialkyl ether - Ether - Azacycle - Carbonyl group - Organic oxygen compound - Primary amine - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Primary aliphatic amine - Amine - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidinecarboxylic acids. These are compounds containing a piperidine ring which bears a carboxylic acid group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tert-butyl 4-(aminomethyl)-4-methoxypiperidine-1-carboxylate |
|---|---|
| INCHI | InChI=1S/C12H24N2O3/c1-11(2,3)17-10(15)14-7-5-12(9-13,16-4)6-8-14/h5-9,13H2,1-4H3 |
| InChIKey | ZIYOADOXUKBYLJ-UHFFFAOYSA-N |
| Smiles | CC(C)(C)OC(=O)N1CCC(CC1)(CN)OC |
| Isomeric SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(CN)OC |
| Alternate CAS | 863561-70-0 |
| PubChem CID | 53399259 |
| Molecular Weight | 244.34 |
| Molecular Weight | 244.330 g/mol |
|---|---|
| XLogP3 | 0.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 244.179 Da |
| Monoisotopic Mass | 244.179 Da |
| Topological Polar Surface Area | 64.800 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 265.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |