Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
t165378-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,520.90
|
|
| Synonyms | tert-butyl4,4-dimethoxy-3-oxopiperidine-1-carboxylate | SY318746 | 4,4-Dimethoxy-3-oxo-piperidine-1-carboxylic acid tert-butyl ester | 1-Boc-4,4-dimethoxypiperidin-3-one | MFCD22123254 | 1007595-82-5 | tert-Butyl 4,4-dimethoxy-3-oxopiperidine-1-carboxylat |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Piperidinecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidinecarboxylic acids |
| Alternative Parents | Piperidinones Ketals Carbamate esters Organic carbonic acids and derivatives Cyclic ketones Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Piperidinecarboxylic acid - Ketal - Piperidinone - Carbamic acid ester - Cyclic ketone - Carbonic acid derivative - Ketone - Azacycle - Acetal - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidinecarboxylic acids. These are compounds containing a piperidine ring which bears a carboxylic acid group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tert-butyl 4,4-dimethoxy-3-oxopiperidine-1-carboxylate |
|---|---|
| INCHI | InChI=1S/C12H21NO5/c1-11(2,3)18-10(15)13-7-6-12(16-4,17-5)9(14)8-13/h6-8H2,1-5H3 |
| InChIKey | MAXHOIBAEYDIQE-UHFFFAOYSA-N |
| Smiles | CC(C)(C)OC(=O)N1CCC(C(=O)C1)(OC)OC |
| Molecular Weight | 259.300 g/mol |
|---|---|
| XLogP3 | 0.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 4 |
| Exact Mass | 259.142 Da |
| Monoisotopic Mass | 259.142 Da |
| Topological Polar Surface Area | 65.099 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 330.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |