Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T174736-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$118.90
|
|
| Synonyms | 1630906-98-7 | tert-butyl 4-[3-(methanesulfonyloxy)propyl]piperazine-1-carboxylate hydrochloride | tert-Butyl 4-(3-((methylsulfonyl)oxy)propyl)piperazine-1-carboxylate hydrochloride | tert-butyl 4-(3-methylsulfonyloxypropyl)piperazine-1-carboxylate;hydrochlorid |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazinanes |
| Subclass | Piperazines |
| Intermediate Tree Nodes | Piperazine carboxylic acids and derivatives |
| Direct Parent | Piperazine carboxylic acids |
| Alternative Parents | N-alkylpiperazines Sulfonic acid esters Organosulfonic acid esters Sulfonyls Methanesulfonates Carbamate esters Trialkylamines Azacyclic compounds Organic oxides Hydrochlorides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Piperazine-1-carboxylic acid - N-alkylpiperazine - Sulfonic acid ester - Organosulfonic acid ester - Methanesulfonate - Organic sulfonic acid or derivatives - Carbamic acid ester - Sulfonyl - Organosulfonic acid or derivatives - Tertiary aliphatic amine - Tertiary amine - Azacycle - Organic oxide - Amine - Organic oxygen compound - Organic nitrogen compound - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Hydrochloride - Carbonyl group - Hydrocarbon derivative - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperazine carboxylic acids. These are heterocyclic compounds containing a piperazine ring substituted by one or more carboxylic acid groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tert-butyl 4-(3-methylsulfonyloxypropyl)piperazine-1-carboxylate;hydrochloride |
|---|---|
| INCHI | InChI=1S/C13H26N2O5S.ClH/c1-13(2,3)20-12(16)15-9-7-14(8-10-15)6-5-11-19-21(4,17)18;/h5-11H2,1-4H3;1H |
| InChIKey | IAYLHXGKUONMPN-UHFFFAOYSA-N |
| Smiles | CC(C)(C)OC(=O)N1CCN(CC1)CCCOS(=O)(=O)C.Cl |
| Molecular Weight | 358.880 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 7 |
| Exact Mass | 358.133 Da |
| Monoisotopic Mass | 358.133 Da |
| Topological Polar Surface Area | 84.500 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 430.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |