Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T173051-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,037.90
|
|
Discover tert-butyl (3R)-3-(2-hydroxyethyl)morpholine-4-carboxylate by Aladdin Scientific in 97% for only $1,037.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1257855-07-4 | (R)-N-Boc-3-(2-hydroxyethyl)morpholine | tert-butyl (3R)-3-(2-hydroxyethyl)morpholine-4-carboxylate | (R)-4-Boc-3-(2-hydroxyethyl)morpholine | (R)-tert-Butyl 3-(2-hydroxyethyl)morpholine-4-carboxylate | SCHEMBL11995203 | MFCD13194715 | AKOS022177114 | AS-4 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Oxazinanes |
| Subclass | Morpholines |
| Intermediate Tree Nodes | Morpholine carboxylic acids and derivatives |
| Direct Parent | Morpholine carboxylic acids |
| Alternative Parents | Carbamate esters Tertiary amines Oxacyclic compounds Dialkyl ethers Azacyclic compounds Primary alcohols Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Morpholine-4-carboxylic acid - Carbamic acid ester - Tertiary amine - Dialkyl ether - Ether - Azacycle - Oxacycle - Organic oxygen compound - Primary alcohol - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Alcohol - Organic oxide - Amine - Carbonyl group - Hydrocarbon derivative - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as morpholine carboxylic acids. These are heterocyclic compounds containing a morpholine ring substituted by one or more carboxylic acid groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tert-butyl (3R)-3-(2-hydroxyethyl)morpholine-4-carboxylate |
|---|---|
| INCHI | InChI=1S/C11H21NO4/c1-11(2,3)16-10(14)12-5-7-15-8-9(12)4-6-13/h9,13H,4-8H2,1-3H3/t9-/m1/s1 |
| InChIKey | ISQYKHGGGYDEKA-SECBINFHSA-N |
| Smiles | CC(C)(C)OC(=O)N1CCOCC1CCO |
| Molecular Weight | 231.290 g/mol |
|---|---|
| XLogP3 | 0.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 231.147 Da |
| Monoisotopic Mass | 231.147 Da |
| Topological Polar Surface Area | 59.000 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 237.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |