Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T172814-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$170.90
|
|
| Synonyms | 1234616-46-6 | tert-butyl 3-bromo-1H-pyrazolo[3,4-b]pyridine-1-carboxylate | 1-BOC-3-BROMO-1H-PYRAZOLO[3,4-B]PYRIDINE | tert-butyl 3-bromopyrazolo[3,4-b]pyridine-1-carboxylate | 1-Boc-3-bromo-1H-pyrazolo... | MFCD17016052 | 1H-pyrazolo[3,4-b]pyridine-1-carboxylic aci |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrazolopyridines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrazolopyridines |
| Alternative Parents | Pyrazole carboxylic acids and derivatives Pyridines and derivatives Aryl bromides Heteroaromatic compounds Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organobromides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyrazolopyridine - Pyrazole-1-carboxylic acid or derivatives - Aryl bromide - Aryl halide - Pyridine - Azole - Pyrazole - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organic oxide - Organooxygen compound - Organonitrogen compound - Organobromide - Organohalogen compound - Hydrocarbon derivative - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrazolopyridines. These are compounds containing a pyrazolopyridine skeleton, which consists of a pyrazole fused to a pyridine. Pyrazole is 5-membered ring consisting of three carbon atoms and two adjacent nitrogen centers. Pyridine is a 6-membered ring with four carbon and one nitrogen atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tert-butyl 3-bromopyrazolo[3,4-b]pyridine-1-carboxylate |
|---|---|
| INCHI | InChI=1S/C11H12BrN3O2/c1-11(2,3)17-10(16)15-9-7(8(12)14-15)5-4-6-13-9/h4-6H,1-3H3 |
| InChIKey | UXDVHLTUWUHLQE-UHFFFAOYSA-N |
| Smiles | CC(C)(C)OC(=O)N1C2=C(C=CC=N2)C(=N1)Br |
| Molecular Weight | 298.140 g/mol |
|---|---|
| XLogP3 | 3.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 297.011 Da |
| Monoisotopic Mass | 297.011 Da |
| Topological Polar Surface Area | 57.000 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 306.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |