Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T627924-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$179.90
|
|
|
T627924-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$286.90
|
|
|
T627924-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$477.90
|
|
|
T627924-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$716.90
|
|
|
T627924-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,586.90
|
|
| Synonyms | 1260672-41-0 | TERT-BUTYL 3-(1H-IMIDAZOL-2-YL)PIPERIDINE-1-CARBOXYLATE | SCHEMBL15551483 | MFCD18250314 | AKOS023120605 | AB72742 | 1-Boc-3-(1H-imidazol-2-yl)piperidine | AS-77793 | CS-0048399 | FT-0760960 | P18891 | t-Butyl 3-(1H-imidazol-2-yl)piperidine |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Piperidinecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidinecarboxylic acids |
| Alternative Parents | Imidazolyl carboxylic acids and derivatives Heteroaromatic compounds Carbamate esters Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Piperidinecarboxylic acid - Imidazolyl carboxylic acid derivative - Heteroaromatic compound - Carbamic acid ester - Imidazole - Azole - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidinecarboxylic acids. These are compounds containing a piperidine ring which bears a carboxylic acid group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tert-butyl 3-(1H-imidazol-2-yl)piperidine-1-carboxylate |
|---|---|
| INCHI | InChI=1S/C13H21N3O2/c1-13(2,3)18-12(17)16-8-4-5-10(9-16)11-14-6-7-15-11/h6-7,10H,4-5,8-9H2,1-3H3,(H,14,15) |
| InChIKey | MNDQVEBOPUBTAA-UHFFFAOYSA-N |
| Smiles | CC(C)(C)OC(=O)N1CCCC(C1)C2=NC=CN2 |
| Isomeric SMILES | CC(C)(C)OC(=O)N1CCCC(C1)C2=NC=CN2 |
| PubChem CID | 72213234 |
| Molecular Weight | 251.33 |
| Molecular Weight | 251.320 g/mol |
|---|---|
| XLogP3 | 1.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 251.163 Da |
| Monoisotopic Mass | 251.163 Da |
| Topological Polar Surface Area | 58.200 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 301.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |