Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T634321-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$242.90
|
|
|
T634321-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$387.90
|
|
|
T634321-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$646.90
|
|
|
T634321-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,165.90
|
|
| Synonyms | (2S,3S)-3-Hydroxy-2-methyl-pyrrolidine-1-carboxylic acid tert-butyl ester | (2S,3S)-tert-Butyl 3-hydroxy-2-methylpyrrolidine-1-carboxylate | MFCD30497639 | rel-(2S,3S)-tert-Butyl 3-hydroxy-2-methylpyrrolidine-1-carboxylate | AT23995 | 1-Pyrrolidinecarboxy |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrrolidines |
| Subclass | Pyrrolidine carboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrrolidine carboxylic acids |
| Alternative Parents | Carbamate esters Tertiary amines Secondary alcohols Azacyclic compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Pyrrolidine carboxylic acid - Carbamic acid ester - Tertiary amine - Secondary alcohol - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Amine - Alcohol - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrrolidine carboxylic acids. These are compounds containing a pyrrolidine ring which bears a carboxylic acid. Pyrrolidine is a five-membered saturated aliphatic heterocycle with one nitrogen atom and four carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tert-butyl (2S,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate |
|---|---|
| INCHI | InChI=1S/C10H19NO3/c1-7-8(12)5-6-11(7)9(13)14-10(2,3)4/h7-8,12H,5-6H2,1-4H3/t7-,8-/m0/s1 |
| InChIKey | RLHMCXQTIPFLRQ-YUMQZZPRSA-N |
| Smiles | CC1C(CCN1C(=O)OC(C)(C)C)O |
| Isomeric SMILES | C[C@H]1[C@H](CCN1C(=O)OC(C)(C)C)O |
| Alternate CAS | 664364-21-0,126874-66-6 |
| PubChem CID | 59273034 |
| Molecular Weight | 201.27 |
| Molecular Weight | 201.260 g/mol |
|---|---|
| XLogP3 | 1.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 201.136 Da |
| Monoisotopic Mass | 201.136 Da |
| Topological Polar Surface Area | 49.800 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 222.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |