Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T627417-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$278.90
|
|
|
T627417-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$445.90
|
|
|
T627417-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$743.90
|
|
|
T627417-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,339.90
|
|
| Synonyms | 1211581-54-2 | tert-butyl 2-chloro-5,6-dihydro-1,7-naphthyridine-7(8H)-carboxylate | tert-butyl 2-chloro-5,8-dihydro-1,7-naphthyridine-7(6H)-carboxylate | tert-butyl 2-chloro-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate | SCHEMBL12540273 | MFCD18261579 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazanaphthalenes |
| Subclass | Naphthyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthyridine carboxylic acids and derivatives |
| Alternative Parents | 2-halopyridines Aryl chlorides Heteroaromatic compounds Carbamate esters Azacyclic compounds Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Naphthyridine carboxylic acid - 2-halopyridine - Aryl chloride - Aryl halide - Pyridine - Heteroaromatic compound - Carbamic acid ester - Azacycle - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organic nitrogen compound - Carbonyl group - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as naphthyridine carboxylic acids and derivatives. These are compounds containing a naphthyridine moiety, where one of the ring atoms bears a carboxylic acid group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tert-butyl 2-chloro-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate |
|---|---|
| INCHI | InChI=1S/C13H17ClN2O2/c1-13(2,3)18-12(17)16-7-6-9-4-5-11(14)15-10(9)8-16/h4-5H,6-8H2,1-3H3 |
| InChIKey | IVFOIKREOFXIDR-UHFFFAOYSA-N |
| Smiles | CC(C)(C)OC(=O)N1CCC2=C(C1)N=C(C=C2)Cl |
| Isomeric SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)N=C(C=C2)Cl |
| PubChem CID | 77231349 |
| Molecular Weight | 268.74 |
| Molecular Weight | 268.740 g/mol |
|---|---|
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 268.098 Da |
| Monoisotopic Mass | 268.098 Da |
| Topological Polar Surface Area | 42.400 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 317.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |