Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T188668-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$964.90
|
|
Discover t-Butyl 2-aminobenzenesulfonamide by Aladdin Scientific in 98% for only $964.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 954268-81-6 | 2-Amino-N-(tert-butyl)benzenesulfonamide | t-Butyl 2-aminobenzenesulfonamide | 2-amino-N-tert-butylbenzene-1-sulfonamide | 2-amino-N-tert-butylbenzenesulfonamide | SCHEMBL3404809 | AMY4693 | DTXSID20588557 | MFCD09738049 | AKOS000145583 | SB79827 | 2-amino-n-tert |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzenesulfonamides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminobenzenesulfonamides |
| Alternative Parents | Benzenesulfonyl compounds Aniline and substituted anilines Organosulfonamides Aminosulfonyl compounds Primary amines Organopnictogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Aminobenzenesulfonamide - Benzenesulfonyl group - Aniline or substituted anilines - Organosulfonic acid amide - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Sulfonyl - Aminosulfonyl compound - Organic oxygen compound - Organic nitrogen compound - Amine - Primary amine - Organosulfur compound - Organonitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organic oxide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aminobenzenesulfonamides. These are organic compounds containing a benzenesulfonamide moiety with an amine group attached to the benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-amino-N-tert-butylbenzenesulfonamide |
|---|---|
| INCHI | InChI=1S/C10H16N2O2S/c1-10(2,3)12-15(13,14)9-7-5-4-6-8(9)11/h4-7,12H,11H2,1-3H3 |
| InChIKey | ILPLPDHFRANPRK-UHFFFAOYSA-N |
| Smiles | CC(C)(C)NS(=O)(=O)C1=CC=CC=C1N |
| Molecular Weight | 228.310 g/mol |
|---|---|
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 228.093 Da |
| Monoisotopic Mass | 228.093 Da |
| Topological Polar Surface Area | 80.600 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 300.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |