Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
S140835-100mg
|
100mg |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$138.90
|
|
| Synonyms | Sudan Red 7B | 6368-72-5 | Solvent Red 19 | Fat red 7B | Typogen Carmine | Hexatype Carmine B | Organol Bordeaux B | Ceres Red 7B | Sudanrot 7B | C.I. Solvent Red 19 | Lacquer Red V3B | Sudan 7B | Solvent Red 019 | Special Blue X 2137 | Fat red bluish | C.I. 26050 | Cerven rozpoustedlov |
|---|---|
| Specifications & Purity | analytical standard |
| Storage Temp | Desiccated |
| Shipped In | Normal |
| Grade | analytical standard |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azobenzenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Azobenzenes |
| Alternative Parents | Naphthalenes Secondary alkylarylamines Benzene and substituted derivatives Azo compounds Propargyl-type 1,3-dipolar organic compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Azobenzene - Naphthalene - Secondary aliphatic/aromatic amine - Benzenoid - Monocyclic benzene moiety - Azo compound - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Secondary amine - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Amine - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as azobenzenes. These are organonitrogen aromatic compounds that contain a central azo group, where each nitrogen atom is conjugated to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | N-ethyl-1-[(4-phenyldiazenylphenyl)diazenyl]naphthalen-2-amine |
|---|---|
| INCHI | InChI=1S/C24H21N5/c1-2-25-23-17-12-18-8-6-7-11-22(18)24(23)29-28-21-15-13-20(14-16-21)27-26-19-9-4-3-5-10-19/h3-17,25H,2H2,1H3 |
| InChIKey | VKWNTWQXVLKCSG-UHFFFAOYSA-N |
| Smiles | CCNC1=C(C2=CC=CC=C2C=C1)N=NC3=CC=C(C=C3)N=NC4=CC=CC=C4 |
| Isomeric SMILES | CCNC1=C(C2=CC=CC=C2C=C1)N=NC3=CC=C(C=C3)N=NC4=CC=CC=C4 |
| WGK Germany | 3 |
| RTECS | QM2850000 |
| PubChem CID | 61396 |
| Molecular Weight | 379.46 |
| Beilstein | 3534323 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Aug 01, 2023 | S140835 |
| Solubility | Miscible with water, soluble in acetone and benzene, slightly soluble in alcohol. |
|---|---|
| Melt Point(°C) | 130°C |
| Molecular Weight | 379.500 g/mol |
| XLogP3 | 7.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 6 |
| Exact Mass | 379.18 Da |
| Monoisotopic Mass | 379.18 Da |
| Topological Polar Surface Area | 61.500 Ų |
| Heavy Atom Count | 29 |
| Formal Charge | 0 |
| Complexity | 533.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |