Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
S196513-100ml
|
100ml |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$21.90
|
|
|
S196513-500ml
|
500ml |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$79.90
|
|
Discover Starch indicator by Aladdin Scientific in 2%(w/v)in water for only $21.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | alpha-Maltose | maltose | Thyodene | 9005-84-9 | 4482-75-1 | Glcalpha1-4Glca | Glcalpha1-4Glcalpha | alpha-D-Glucopyranose, 4-o-alpha-D-glucopyranosyl- | 15SUG9AD26 | Amylodextrin | Maltose solution, 20% in H2O | 4-O-alpha-D-glucopyranosyl-alpha-D-glucopyranose | alpha-D-Glcp-(1 |
|---|---|
| Specifications & Purity | 2%(w/v)in water |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Glycosyl compounds |
| Direct Parent | O-glycosyl compounds |
| Alternative Parents | Disaccharides Oxanes Secondary alcohols Hemiacetals Polyols Oxacyclic compounds Acetals Primary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | O-glycosyl compound - Disaccharide - Oxane - Secondary alcohol - Hemiacetal - Oxacycle - Organoheterocyclic compound - Polyol - Acetal - Hydrocarbon derivative - Primary alcohol - Alcohol - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as o-glycosyl compounds. These are glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond. |
| External Descriptors | maltose |
|
|
|
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
|---|---|
| INCHI | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11+,12-/m1/s1 |
| InChIKey | GUBGYTABKSRVRQ-ASMJPISFSA-N |
| Smiles | O1[C@@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)O[C@@H]2[C@H](O[C@@H]([C@@H]([C@H]2O)O)O)CO |
| Isomeric SMILES | O1[C@@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)O[C@@H]2[C@H](O[C@@H]([C@@H]([C@H]2O)O)O)CO |
| WGK Germany | 1 |
| Reaxy-Rn | 1351180 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1351180&ln= |
| Melt Point(°C) | 256-258℃ |
|---|---|
| Molecular Weight | 342.300 g/mol |
| XLogP3 | -4.700 |
| Hydrogen Bond Donor Count | 8 |
| Hydrogen Bond Acceptor Count | 11 |
| Rotatable Bond Count | 4 |
| Exact Mass | 342.116 Da |
| Monoisotopic Mass | 342.116 Da |
| Topological Polar Surface Area | 190.000 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 382.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 10 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |