Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
S632059-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$157.90
|
|
|
S632059-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$251.90
|
|
|
S632059-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$419.90
|
|
|
S632059-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$629.90
|
|
|
S632059-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,151.90
|
|
| Synonyms | Spiro[2.3]hexan-4-ol | EN300-7585448 | DTXSID20498006 | SB22710 | spiro[2.3]hexan-6-ol | AKOS026717058 | F2147-4386 | D96738 | PS-17241 | MFCD30002909 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Alcohols and polyols |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cyclic alcohols and derivatives |
| Alternative Parents | Secondary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Secondary alcohol - Cyclobutanol - Hydrocarbon derivative - Aliphatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as cyclic alcohols and derivatives. These are organic compounds containing an aliphatic ring substituted with at least one hydroxyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | spiro[2.3]hexan-6-ol |
|---|---|
| INCHI | InChI=1S/C6H10O/c7-5-1-2-6(5)3-4-6/h5,7H,1-4H2 |
| InChIKey | RUZFXXZSPJQNDV-UHFFFAOYSA-N |
| Smiles | C1CC2(C1O)CC2 |
| Isomeric SMILES | C1CC2(C1O)CC2 |
| Alternate CAS | 21816-25-1 |
| PubChem CID | 12431565 |
| Molecular Weight | 98.14 |
| Molecular Weight | 98.140 g/mol |
|---|---|
| XLogP3 | 0.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 98.0732 Da |
| Monoisotopic Mass | 98.0732 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 7 |
| Formal Charge | 0 |
| Complexity | 94.400 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |