Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
S112963-250g
|
250g |
3
|
$43.90
|
|
| Synonyms | Endrin 20 EC | Protachem SMP | Rheodol SP-P 10 | AI3-03901 | BCP14221 | Crill 2 | EINECS 247-568-8 | [(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] hexadecanoate | SORBITAN PALMITATE [INCI] | SORBITAN, MONOHEXADECANOATE | DSSTox_CID_9335 | |
|---|---|
| Specifications & Purity | Reagent grade |
| Shipped In | Normal |
| Grade | Reagent Grade |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Fatty acid esters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fatty acid esters |
| Alternative Parents | Tetrahydrofurans Secondary alcohols Carboxylic acid esters Oxacyclic compounds Monocarboxylic acids and derivatives Dialkyl ethers Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Fatty acid ester - Tetrahydrofuran - Carboxylic acid ester - Secondary alcohol - Carboxylic acid derivative - Dialkyl ether - Ether - Monocarboxylic acid or derivatives - Oxacycle - Organoheterocyclic compound - Carbonyl group - Organic oxide - Alcohol - Organooxygen compound - Hydrocarbon derivative - Organic oxygen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as fatty acid esters. These are carboxylic ester derivatives of a fatty acid. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488199160 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488199160 |
| IUPAC Name | [(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] hexadecanoate |
| INCHI | InChI=1S/C22H42O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20(25)27-17-19(24)22-21(26)18(23)16-28-22/h18-19,21-24,26H,2-17H2,1H3/t18-,19+,21+,22+/m0/s1 |
| InChIKey | IYFATESGLOUGBX-YVNJGZBMSA-N |
| Smiles | CCCCCCCCCCCCCCCC(=O)OCC(C1C(C(CO1)O)O)O |
| Isomeric SMILES | CCCCCCCCCCCCCCCC(=O)OC[C@H]([C@@H]1[C@@H]([C@H](CO1)O)O)O |
| WGK Germany | 1 |
| RTECS | WG2932900 |
| PubChem CID | 16212480 |
| Molecular Weight | 402.57 |
| Reaxy-Rn | 10040938 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Apr 20, 2023 | S112963 | |
| Certificate of Analysis | Apr 20, 2023 | S112963 | |
| Certificate of Analysis | Apr 20, 2023 | S112963 | |
| Certificate of Analysis | Feb 18, 2023 | S112963 | |
| Certificate of Analysis | Feb 06, 2023 | S112963 | |
| Certificate of Analysis | Jun 25, 2022 | S112963 | |
| Certificate of Analysis | Jun 25, 2022 | S112963 |
| Sensitivity | Moisture sensitive. |
|---|---|
| Flash Point(°F) | 235.4℉ |
| Flash Point(°C) | 113°C |
| Melt Point(°C) | 46-47°C |
| Molecular Weight | 402.600 g/mol |
| XLogP3 | 5.800 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 18 |
| Exact Mass | 402.298 Da |
| Monoisotopic Mass | 402.298 Da |
| Topological Polar Surface Area | 96.200 Ų |
| Heavy Atom Count | 28 |
| Formal Charge | 0 |
| Complexity | 389.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |