Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
I134321-100mg
|
100mg |
5
|
$34.90
|
|
|
I134321-250mg
|
250mg |
5
|
$65.90
|
|
|
I134321-1g
|
1g |
5
|
$201.90
|
|
| Synonyms | 168297-84-5 | (S)-5,5-Dimethyl-4-phenyl-2-oxazolidinone | (S)-Phenyl superquat | (S)-(+)-5,5-Dimethyl-4-phenyl-2-oxazolidinone | (4S)-5,5-dimethyl-4-phenyl-1,3-oxazolidin-2-one | 2-Oxazolidinone, 5,5-dimethyl-4-phenyl-, (4S)- | (S)-5,5-dimethyl-4-phenyloxazolidin-2-o |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azolidines |
| Subclass | Oxazolidines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Oxazolidinones |
| Alternative Parents | Benzene and substituted derivatives Carbamate esters Organic carbonic acids and derivatives Oxacyclic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Monocyclic benzene moiety - Oxazolidinone - Benzenoid - Carbamic acid ester - Carbonic acid derivative - Oxacycle - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Carbonyl group - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as oxazolidinones. These are compounds containing an oxazolidinone moiety, which is an oxazolidine bearing a ketone group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504761035 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504761035 |
| IUPAC Name | (4S)-5,5-dimethyl-4-phenyl-1,3-oxazolidin-2-one |
| INCHI | InChI=1S/C11H13NO2/c1-11(2)9(12-10(13)14-11)8-6-4-3-5-7-8/h3-7,9H,1-2H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | HSQRCAULDOQKPF-VIFPVBQESA-N |
| Smiles | CC1(C(NC(=O)O1)C2=CC=CC=C2)C |
| Isomeric SMILES | CC1([C@@H](NC(=O)O1)C2=CC=CC=C2)C |
| WGK Germany | 3 |
| Molecular Weight | 191.23 |
| Reaxy-Rn | 1211327 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1211327&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Feb 07, 2025 | I134321 | |
| Certificate of Analysis | Feb 07, 2025 | I134321 | |
| Certificate of Analysis | Feb 07, 2025 | I134321 | |
| Certificate of Analysis | Feb 07, 2025 | I134321 | |
| Certificate of Analysis | Feb 07, 2025 | I134321 | |
| Certificate of Analysis | Feb 07, 2025 | I134321 |
| Specific Rotation[α] | [α]25/D +71°, c = 2 in chloroform |
|---|---|
| Melt Point(°C) | 151-156 °C (lit.) |
| Molecular Weight | 191.230 g/mol |
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 191.095 Da |
| Monoisotopic Mass | 191.095 Da |
| Topological Polar Surface Area | 38.300 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 231.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |