Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B121555-1g
|
1g |
5
|
$36.90
|
|
|
B121555-5g
|
5g |
1
|
$142.90
|
|
|
B121555-10g
|
10g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$256.90
|
|
|
B121555-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$577.90
|
|
| Synonyms | 140695-84-7 | (S)-1-Boc-3-(Hydroxymethyl)Piperidine | tert-butyl (3S)-3-(hydroxymethyl)piperidine-1-carboxylate | (s)-tert-butyl 3-(hydroxymethyl)piperidine-1-carboxylate | (s)-n-boc-3-piperidinemethanol | (s)-1-boc-3-(hyroxymethyl)piperidine | (S)-1-N-Boc-3-hydroxym |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Piperidinecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidinecarboxylic acids |
| Alternative Parents | Carbamate esters Organic carbonic acids and derivatives Azacyclic compounds Primary alcohols Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Piperidinecarboxylic acid - Carbamic acid ester - Carbonic acid derivative - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Organonitrogen compound - Carbonyl group - Alcohol - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidinecarboxylic acids. These are compounds containing a piperidine ring which bears a carboxylic acid group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488191911 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488191911 |
| IUPAC Name | tert-butyl (3S)-3-(hydroxymethyl)piperidine-1-carboxylate |
| INCHI | InChI=1S/C11H21NO3/c1-11(2,3)15-10(14)12-6-4-5-9(7-12)8-13/h9,13H,4-8H2,1-3H3/t9-/m0/s1 |
| InChIKey | OJCLHERKFHHUTB-VIFPVBQESA-N |
| Smiles | CC(C)(C)OC(=O)N1CCCC(C1)CO |
| Isomeric SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C1)CO |
| Molecular Weight | 215.29 |
| Reaxy-Rn | 5850868 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=5850868&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Apr 09, 2025 | B121555 | |
| Certificate of Analysis | Oct 09, 2023 | B121555 | |
| Certificate of Analysis | Mar 21, 2023 | B121555 |
| Molecular Weight | 215.290 g/mol |
|---|---|
| XLogP3 | 1.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 215.152 Da |
| Monoisotopic Mass | 215.152 Da |
| Topological Polar Surface Area | 49.800 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 222.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |