Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
R476456-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$105.90
|
|
|
R476456-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$525.90
|
|
| Synonyms | rubreneperoxide | Q415911 | 5,11,12-Tetraphenylnaphthacene | Naphthacene,6,11,12-tetraphenyl- | 5,6,11,12-tetraphenyl-naphthacene, (rubrene) | 5,6,11,12-Tetraphenyltetracene | A828751 | Rubrene, sublimed grade, 99.99% trace metals basis | AKOS015840537 | |
|---|---|
| Specifications & Purity | powder |
| Product Description |
Description Reagent for chemiluminescence research and for transition metal complex ligation. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lignans, neolignans and related compounds |
| Class | Arylnaphthalene lignans |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Arylnaphthalene lignans |
| Alternative Parents | Linear diarylheptanoids Naphthacenes Benzene and substituted derivatives Aromatic hydrocarbons Polycyclic hydrocarbons Unsaturated hydrocarbons |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Linear 1,7-diphenylheptane skeleton - Arylnaphthalene lignan skeleton - Tetracene - Benzenoid - Monocyclic benzene moiety - Aromatic hydrocarbon - Polycyclic hydrocarbon - Unsaturated hydrocarbon - Hydrocarbon - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as arylnaphthalene lignans. These are lignans containing the arylnaphthalene skeleton, especially 9-(2H-1,3-benzodioxol-5-yl)-1H,3H-naphtho[2,3-c]furan-1-one or a derivative thereof. Arylnaphthalene lignans occur in nature and exhibit diverse biological activities. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5,6,11,12-tetraphenyltetracene |
|---|---|
| INCHI | InChI=1S/C42H28/c1-5-17-29(18-6-1)37-33-25-13-14-26-34(33)39(31-21-9-3-10-22-31)42-40(32-23-11-4-12-24-32)36-28-16-15-27-35(36)38(41(37)42)30-19-7-2-8-20-30/h1-28H |
| InChIKey | YYMBJDOZVAITBP-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=C(C5=CC=CC=C5C(=C24)C6=CC=CC=C6)C7=CC=CC=C7)C8=CC=CC=C8 |
| Isomeric SMILES | C1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=C(C5=CC=CC=C5C(=C24)C6=CC=CC=C6)C7=CC=CC=C7)C8=CC=CC=C8 |
| WGK Germany | 3 |
| PubChem CID | 68203 |
| Molecular Weight | 532.67 |
| Beilstein | 1917339 |
| Reaxy-Rn | 1917339 |
| Melt Point(°C) | 330-335 °C |
|---|---|
| Molecular Weight | 532.700 g/mol |
| XLogP3 | 12.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 4 |
| Exact Mass | 532.219 Da |
| Monoisotopic Mass | 532.219 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 42 |
| Formal Charge | 0 |
| Complexity | 696.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |