Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
R473778-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$173.90
|
|
| Synonyms | EN300-6768410 | SCHEMBL503695 | A50840 | (R)-(-)-Hexahydromandelic acid | (r)-(-)-2-cyclohexyl-2-hydroxyacetic acid | AKOS022183289 | (R)-2-Cyclohexyl-2-hydroxyaceticacid | (R)-2-Cyclohexyl-2-hydroxyacetic acid | AS-63269 | (R)-(-)-Hexahydromandelic acid, |
|---|---|
| Specifications & Purity | ≥98%,≥99%(ee) |
| Product Description |
Description (R)-(−)-Hexahydromandelic acid can be used:As an intermediate in the synthesis of antimycobacterial compound pyridomycin analogs.As a model α-hydroxy acid compound in the chirality sensing studies of organic probes using circular dichroism technique.As a starting material in the synthesis of chiral ionic liquids, which are applicable as chiral solvents in asymmetric synthesis and as chiral stationary phases in chromatographic separations. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Hydroxy acids and derivatives |
| Subclass | Alpha hydroxy acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alpha hydroxy acids and derivatives |
| Alternative Parents | Secondary alcohols Monocarboxylic acids and derivatives Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Alpha-hydroxy acid - Secondary alcohol - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Alcohol - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alpha hydroxy acids and derivatives. These are organic compounds containing a carboxylic acid substituted with a hydroxyl group on the adjacent carbon. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (2R)-2-cyclohexyl-2-hydroxyacetic acid |
|---|---|
| INCHI | InChI=1S/C8H14O3/c9-7(8(10)11)6-4-2-1-3-5-6/h6-7,9H,1-5H2,(H,10,11)/t7-/m1/s1 |
| InChIKey | RRDPWAPIJGSANI-SSDOTTSWSA-N |
| Smiles | C1CCC(CC1)C(C(=O)O)O |
| Isomeric SMILES | C1CCC(CC1)[C@H](C(=O)O)O |
| WGK Germany | 3 |
| Molecular Weight | 158.19 |
| Reaxy-Rn | 3196810 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3196810&ln= |
| Specific Rotation[α] | [α]18/D −23°, c = 1 in acetic acid |
|---|---|
| Melt Point(°C) | 127-129 °C |
| Molecular Weight | 158.190 g/mol |
| XLogP3 | 1.500 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 158.094 Da |
| Monoisotopic Mass | 158.094 Da |
| Topological Polar Surface Area | 57.500 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 138.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |