Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
R472683-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$216.90
|
|
| Synonyms | (R)-(+)-4-Methoxymandelonitrile | (r)-4-methoxymandelonitrile | SCHEMBL9185138 | AKOS024386623 | (R)-2-Hydroxy-2-(4-methoxyphenyl)acetonitrile | DTXSID00473038 | (R)-(+)-4-Methoxymandelonitrile, 98% | (2R)-2-hydroxy-2-(4-methoxyphenyl)acetonitrile |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
| Product Description |
Description Useful intermediate in the preparation of optically active α-hydroxy carboxylic acids, α-hydroxy aldehydes, α-hydroxy ketones, and 2-amino alcohols. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Anisoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Anisoles |
| Alternative Parents | Phenoxy compounds Methoxybenzenes Alkyl aryl ethers Secondary alcohols Cyanohydrins Alpha-hydroxynitriles Hydrocarbon derivatives Aromatic alcohols |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Anisole - Methoxybenzene - Alkyl aryl ether - Monocyclic benzene moiety - Cyanohydrin - Secondary alcohol - Alpha-hydroxynitrile - Nitrile - Carbonitrile - Ether - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Alcohol - Cyanide - Aromatic alcohol - Organic oxygen compound - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as anisoles. These are organic compounds containing a methoxybenzene or a derivative thereof. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (2R)-2-hydroxy-2-(4-methoxyphenyl)acetonitrile |
|---|---|
| INCHI | InChI=1S/C9H9NO2/c1-12-8-4-2-7(3-5-8)9(11)6-10/h2-5,9,11H,1H3/t9-/m0/s1 |
| InChIKey | WLDAAMXETLHTER-VIFPVBQESA-N |
| Smiles | COC1=CC=C(C=C1)C(C#N)O |
| Isomeric SMILES | COC1=CC=C(C=C1)[C@H](C#N)O |
| WGK Germany | 3 |
| PubChem CID | 11805082 |
| Molecular Weight | 163.17 |
| Molecular Weight | 163.170 g/mol |
|---|---|
| XLogP3 | 0.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 163.063 Da |
| Monoisotopic Mass | 163.063 Da |
| Topological Polar Surface Area | 53.300 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 176.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |