Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
R472348-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$406.90
|
|
| Synonyms | (4R)-5,5-dimethyl-4-propan-2-yl-1,3-oxazolidin-2-one | (R)-(+)-4-isopropyl-5,5-dimethyloxazolidin-2-one | SCHEMBL2365869 | (R)-(+)-4-Isopropyl-5,5-dimethyl-2-oxazolidinone, 98% | (4R)-5,5-dimethyl-4-(propan-2-yl)-1,3-oxazolidin-2-one | (R)-4-Isopropyl-5,5 |
|---|---|
| Specifications & Purity | ≥98% |
| Product Description |
Description Versatile chiral auxiliary for asymmetric synthesis used in diastereoselective Michael additions. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azolidines |
| Subclass | Oxazolidines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Oxazolidinones |
| Alternative Parents | Carbamate esters Oxacyclic compounds Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Oxazolidinone - Carbamic acid ester - Oxacycle - Azacycle - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as oxazolidinones. These are compounds containing an oxazolidinone moiety, which is an oxazolidine bearing a ketone group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (4R)-5,5-dimethyl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| INCHI | InChI=1S/C8H15NO2/c1-5(2)6-8(3,4)11-7(10)9-6/h5-6H,1-4H3,(H,9,10)/t6-/m1/s1 |
| InChIKey | QICFUFOXXNIZFF-ZCFIWIBFSA-N |
| Smiles | CC(C)C1C(OC(=O)N1)(C)C |
| Isomeric SMILES | CC(C)[C@@H]1C(OC(=O)N1)(C)C |
| WGK Germany | 3 |
| PubChem CID | 10583042 |
| Molecular Weight | 157.21 |
| Molecular Weight | 157.210 g/mol |
|---|---|
| XLogP3 | 1.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 157.11 Da |
| Monoisotopic Mass | 157.11 Da |
| Topological Polar Surface Area | 38.300 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 175.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |