Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M631140-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$387.90
|
|
|
M631140-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,553.90
|
|
|
M631140-10g
|
10g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,105.90
|
|
| Synonyms | (R)-(1-Methyl-azetidin-2-yl)-methanol | 1932543-77-5 | (R)-(1-Methylazetidin-2-yl)methanol | SCHEMBL13132243 | MFCD22397977 | CS-0172773 | P18351 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azetidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Azetidines |
| Alternative Parents | Trialkylamines 1,2-aminoalcohols Azacyclic compounds Primary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Tertiary aliphatic amine - Tertiary amine - Azetidine - 1,2-aminoalcohol - Azacycle - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Organonitrogen compound - Amine - Alcohol - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as azetidines. These are organic compounds containing a saturated four-member heterocycle where one nitrogen atom replaces a carbon atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | [(2R)-1-methylazetidin-2-yl]methanol |
|---|---|
| INCHI | InChI=1S/C5H11NO/c1-6-3-2-5(6)4-7/h5,7H,2-4H2,1H3/t5-/m1/s1 |
| InChIKey | ODRFPWJCWBQAJR-RXMQYKEDSA-N |
| Smiles | CN1CCC1CO |
| Isomeric SMILES | CN1CC[C@@H]1CO |
| PubChem CID | 59504978 |
| Molecular Weight | 101.15 |
| Molecular Weight | 101.150 g/mol |
|---|---|
| XLogP3 | -0.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 101.084 Da |
| Monoisotopic Mass | 101.084 Da |
| Topological Polar Surface Area | 23.500 Ų |
| Heavy Atom Count | 7 |
| Formal Charge | 0 |
| Complexity | 65.099 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |