Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P160423-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$26.90
|
|
|
P160423-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$94.90
|
|
|
P160423-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$329.90
|
|
| Synonyms | 3-Carbamoyl-2-pyrazinecarboxylic acid | 3-(Aminocarbonyl)pyrazine-2-carboxylic acid | 3-carbamoylpyrazine-2-carboxylic acid | SCHEMBL931331 | VIBWYIDVHOAVJB-UHFFFAOYSA |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrazines |
| Intermediate Tree Nodes | Pyrazine carboxylic acids and derivatives |
| Direct Parent | Pyrazinecarboxamides |
| Alternative Parents | Pyrazine carboxylic acids 2-heteroaryl carboxamides Heteroaromatic compounds Primary carboxylic acid amides Monocarboxylic acids and derivatives Carboxylic acids Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyrazine carboxylic acid - Pyrazinecarboxamide - 2-heteroaryl carboxamide - Heteroaromatic compound - Carboxamide group - Primary carboxylic acid amide - Carboxylic acid derivative - Carboxylic acid - Monocarboxylic acid or derivatives - Azacycle - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organopnictogen compound - Organic oxide - Organic nitrogen compound - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrazinecarboxamides. These are compounds containing a pyrazine ring which bears a carboxamide. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3-carbamoylpyrazine-2-carboxylic acid |
|---|---|
| INCHI | InChI=1S/C6H5N3O3/c7-5(10)3-4(6(11)12)9-2-1-8-3/h1-2H,(H2,7,10)(H,11,12) |
| InChIKey | VIBWYIDVHOAVJB-UHFFFAOYSA-N |
| Smiles | C1=CN=C(C(=N1)C(=O)N)C(=O)O |
| Isomeric SMILES | C1=CN=C(C(=N1)C(=O)N)C(=O)O |
| PubChem CID | 556798 |
| Molecular Weight | 167.12 |
| Reaxy-Rn | 147980 |
| Molecular Weight | 167.120 g/mol |
|---|---|
| XLogP3 | -1.300 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 2 |
| Exact Mass | 167.033 Da |
| Monoisotopic Mass | 167.033 Da |
| Topological Polar Surface Area | 106.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 206.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Starting at $33.90
Starting at $33.90
Starting at $37.90