Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P421898-1ml
|
1ml |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$69.90
|
|
| Synonyms | 158474-72-7 | Prohydrojasmon racemate | Cyclopentaneacetic acid, 3-oxo-2-pentyl-, propyl ester | PROPYL 2-(3-OXO-2-PENTYLCYCLOPENTYL)ACETATE | propyl dihydrojasmonate | Prohydrojasmon (racemate) | Prohydrojasmon, isomer 1 | SCHEMBL3245957 | DTXSID30870056 | IPDFPNNPBMREIF- |
|---|---|
| Specifications & Purity | 10mM in DMSO |
| Storage Temp | Store at -80°C |
| Shipped In |
Dry ice packs + Cold packs This product requires cold chain shipping. Ground and other economy services are not available. |
| Product Description |
Prohydrojasmon racemate (n-Propyl dihydrojasmonate) is the racemate of Prohydrojasmon. Prohydrojasmon is a synthesized plant growth regulator |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Lineolic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Jasmonic acids |
| Alternative Parents | Cyclic ketones Carboxylic acid esters Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Jasmonic acid - Cyclic ketone - Ketone - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as jasmonic acids. These are lipids containing or derived from a jasmonic acid, with a structure characterized by the presence of an alkene chain linked to a 2-(3-oxocyclopentyl)acetic acid moiety. |
| External Descriptors | Not available |
|
|
|
| ALogP | 3.673 |
|---|---|
| Rotatable Bond | 9 |
| IUPAC Name | propyl 2-(3-oxo-2-pentylcyclopentyl)acetate |
|---|---|
| INCHI | InChI=1S/C15H26O3/c1-3-5-6-7-13-12(8-9-14(13)16)11-15(17)18-10-4-2/h12-13H,3-11H2,1-2H3 |
| InChIKey | IPDFPNNPBMREIF-UHFFFAOYSA-N |
| Smiles | CCCCCC1C(CCC1=O)CC(=O)OCCC |
| Isomeric SMILES | CCCCCC1C(CCC1=O)CC(=O)OCCC |
| PubChem CID | 11184378 |
| Molecular Weight | 254.37 |
| Molecular Weight | 254.360 g/mol |
|---|---|
| XLogP3 | 3.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 9 |
| Exact Mass | 254.188 Da |
| Monoisotopic Mass | 254.188 Da |
| Topological Polar Surface Area | 43.400 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 273.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |