Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P139718-25g
|
25g |
4
|
$18.90
|
|
|
P139718-100g
|
100g |
1
|
$64.90
|
|
|
P139718-500g
|
500g |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$82.90
|
|
| Synonyms | Emanon 3199 | Cerasynt MN | Lactine | MYS 40 | Nikkol MYS 4 | PEG 42 | Akyporox S 100 | Cerasynt M | Nonex 63 | PEG-40 stearate | Soromin-SG | 2-Hydroxyethyl octadecanoate | PEG-8 Stearate | Usaf ke-12 | Prodhybas N | 2-Hydroxyethyl stearate | Pegosperse |
|---|---|
| Specifications & Purity | n≈45 |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Fatty acid esters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fatty acid esters |
| Alternative Parents | Carboxylic acid esters Monocarboxylic acids and derivatives Primary alcohols Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Fatty acid ester - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Carbonyl group - Alcohol - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as fatty acid esters. These are carboxylic ester derivatives of a fatty acid. |
| External Descriptors | Not available |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | 2-hydroxyethyl octadecanoate |
|---|---|
| INCHI | InChI=1S/C20H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)23-19-18-21/h21H,2-19H2,1H3 |
| InChIKey | RFVNOJDQRGSOEL-UHFFFAOYSA-N |
| Smiles | CCCCCCCCCCCCCCCCCC(=O)OCCO |
| Isomeric SMILES | CCCCCCCCCCCCCCCCCC(=O)OCCO |
| WGK Germany | 1 |
| RTECS | MD0907300 |
| Reaxy-Rn | 1794033 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1794033&ln= |
| Melt Point(°C) | 56.5-61.5°C |
|---|---|
| Molecular Weight | 328.500 g/mol |
| XLogP3 | 7.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 19 |
| Exact Mass | 328.298 Da |
| Monoisotopic Mass | 328.298 Da |
| Topological Polar Surface Area | 46.500 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 241.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |