Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P304885-500g
|
500g |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$643.90
|
|
| Synonyms | ISOBUTYLENE | Isobutene | 2-Methylpropene | 2-methylprop-1-ene | 115-11-7 | 2-Methylpropylene | 2-Methyl-1-propene | 1,1-Dimethylethylene | 1-Propene, 2-methyl- | Isopropylidenemethylene | Methylpropene | gamma-Butylene | Propene, 2-methyl- | 1,1-Dimethylethene | iso-butene | 9003-27- |
|---|---|
| Specifications & Purity | average Mv 85000,average Mw 108000 |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Hydrocarbons |
| Class | Unsaturated hydrocarbons |
| Subclass | Branched unsaturated hydrocarbons |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Branched unsaturated hydrocarbons |
| Alternative Parents | Unsaturated aliphatic hydrocarbons Alkenes |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Branched unsaturated hydrocarbon - Unsaturated aliphatic hydrocarbon - Olefin - Alkene - Acyclic olefin - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as branched unsaturated hydrocarbons. These are hydrocarbons that contains one or more unsaturated carbon atoms, and an aliphatic branch. |
| External Descriptors | alkene |
|
|
|
| IUPAC Name | 2-methylprop-1-ene |
|---|---|
| INCHI | InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3 |
| InChIKey | VQTUBCCKSQIDNK-UHFFFAOYSA-N |
| Smiles | CC(=C)C |
| Isomeric SMILES | CC(=C)C |
| Reaxy-Rn | 773645 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=773645&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jan 14, 2025 | P304885 | |
| Certificate of Analysis | Jan 14, 2025 | P304885 | |
| Certificate of Analysis | Mar 14, 2022 | P304885 |
| Molecular Weight | 56.110 g/mol |
|---|---|
| XLogP3 | 2.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 56.0626 Da |
| Monoisotopic Mass | 56.0626 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 4 |
| Formal Charge | 0 |
| Complexity | 23.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |