Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P304893-500g
|
500g |
3
|
$89.90
|
|
| Synonyms | 2-Hydroxyethyl oleate | Glycol oleate | 4500-01-0 | Ethylene glycol monooleate | 2-hydroxyethyl (Z)-octadec-9-enoate | 9-Octadecenoic acid (Z)-, 2-hydroxyethyl ester | Glycol monooleate | Oleic acid, 2-hydroxyethyl ester | 9-Octadecenoic acid (9Z)-, 2-hydroxyethyl ester | |
|---|---|
| Specifications & Purity | PEG600MO |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Fatty acid esters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fatty acid esters |
| Alternative Parents | Carboxylic acid esters Monocarboxylic acids and derivatives Primary alcohols Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Fatty acid ester - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Carbonyl group - Alcohol - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as fatty acid esters. These are carboxylic ester derivatives of a fatty acid. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504763729 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504763729 |
| IUPAC Name | 2-hydroxyethyl (Z)-octadec-9-enoate |
| INCHI | InChI=1S/C20H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)23-19-18-21/h9-10,21H,2-8,11-19H2,1H3/b10-9- |
| InChIKey | MUHFRORXWCGZGE-KTKRTIGZSA-N |
| Smiles | CCCCCCCCC=CCCCCCCCC(=O)OCCO |
| Isomeric SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCO |
| PubChem CID | 5364420 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | May 16, 2024 | P304893 | |
| Certificate of Analysis | May 16, 2024 | P304893 | |
| Certificate of Analysis | Jun 22, 2021 | P304893 |
| Solubility | propylene glycol: insoluble,toluene, ethanol, acetone and water: soluble |
|---|---|
| Molecular Weight | 326.500 g/mol |
| XLogP3 | 6.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 18 |
| Exact Mass | 326.282 Da |
| Monoisotopic Mass | 326.282 Da |
| Topological Polar Surface Area | 46.500 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 274.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 1 |
| Covalently-Bonded Unit Count | 1 |