Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P432988-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$260.90
|
|
| Synonyms | 2-methoxyethyl-p-toluenesulfonate | SY047023 | T1303 | Ethanol, 2-methoxy-, 1-(4-methylbenzenesulfonate) | 2-methoxyethyltosylate | p-toluene sulfonic acid 2-methoxyethyl ester | 2-methoxyethyl 4-methylbenzene-1-sulfonate | AKOS005111040 | 2-methoxyethyl |
|---|---|
| Specifications & Purity | average Mn 900 |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzenesulfonic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzenesulfonate esters |
| Alternative Parents | p-Methylbenzenesulfonates Tosyl compounds Benzenesulfonyl compounds Arylsulfonic acids and derivatives Organosulfonic acid esters Sulfonyls Dialkyl ethers Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzenesulfonate ester - P-methylbenzenesulfonate - Tosyl compound - Arylsulfonic acid or derivatives - Benzenesulfonyl group - Toluene - Organosulfonic acid ester - Sulfonyl - Organosulfonic acid or derivatives - Organic sulfonic acid or derivatives - Dialkyl ether - Ether - Organic oxygen compound - Organosulfur compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzenesulfonate esters. These are arenesulfonate esters that result from the formal condensation of the hydroxy group of an alcohol, enol, phenol or heteroarenol with benzenesulfonic acid. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-methoxyethyl 4-methylbenzenesulfonate |
|---|---|
| INCHI | InChI=1S/C10H14O4S/c1-9-3-5-10(6-4-9)15(11,12)14-8-7-13-2/h3-6H,7-8H2,1-2H3 |
| InChIKey | TZXJJSAQSRHKCZ-UHFFFAOYSA-N |
| Smiles | CC1=CC=C(C=C1)S(=O)(=O)OCCOC |
| Isomeric SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOC |
| WGK Germany | 3 |
| Reaxy-Rn | 2376237 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2376237&ln= |
| Flash Point(°F) | >230 °F |
|---|---|
| Flash Point(°C) | >110 °C |
| Molecular Weight | 230.280 g/mol |
| XLogP3 | 1.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Exact Mass | 230.061 Da |
| Monoisotopic Mass | 230.061 Da |
| Topological Polar Surface Area | 61.000 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 260.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |