Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C128161-1ml
|
1ml |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$158.90
|
|
| Synonyms | 4-Chlorotoluene | 106-43-4 | 1-Chloro-4-methylbenzene | P-CHLOROTOLUENE | Benzene, 1-chloro-4-methyl- | p-Tolyl chloride | Toluene, p-chloro- | 1-Methyl-4-chlorobenzene | 4-Chloro-1-methylbenzene | para-Chlorotoluene | 4-methylchlorobenzene | NSC 404114 | 4-CHLOROTOLUENE-D7 | 1-ch |
|---|---|
| Specifications & Purity | 2000ug/ml in Purge and Trap Methanol |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
| Product Description |
Volatile Organic Compounds (VOCs) Single Component Standards US EPA Methods:502.2,524.2,8021,8021A,8021B,624,8240B,8260B |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Chlorobenzenes |
| Alternative Parents | Toluenes Aryl chlorides Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Toluene - Chlorobenzene - Aryl halide - Aryl chloride - Hydrocarbon derivative - Organochloride - Organohalogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as chlorobenzenes. These are compounds containing one or more chlorine atoms attached to a benzene moiety. |
| External Descriptors | a small molecule |
|
|
|
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | 1-chloro-4-methylbenzene |
|---|---|
| INCHI | InChI=1S/C7H7Cl/c1-6-2-4-7(8)5-3-6/h2-5H,1H3 |
| InChIKey | NPDACUSDTOMAMK-UHFFFAOYSA-N |
| Smiles | CC1=CC=C(C=C1)Cl |
| Isomeric SMILES | CC1=CC=C(C=C1)Cl |
| WGK Germany | 1 |
| UN Number | 1230 |
| Packing Group | II |
| Molecular Weight | 126.59 |
| Beilstein | 1903635 |
| Reaxy-Rn | 1903635 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1903635&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Sep 12, 2023 | C128161 |
| Refractive Index | 1.52 |
|---|---|
| Flash Point(°F) | 11 °C |
| Flash Point(°C) | 11°C |
| Boil Point(°C) | 162°C |
| Melt Point(°C) | 6-8 °C |
| Molecular Weight | 126.580 g/mol |
| XLogP3 | 3.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 126.024 Da |
| Monoisotopic Mass | 126.024 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 62.800 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |