Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
O159914-200mg
|
200mg |
2
|
$12.90
|
|
|
O159914-1g
|
1g |
3
|
$46.90
|
|
|
O159914-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$187.90
|
|
| Synonyms | O-Benzoyl-N-methylhydroxylamineHydrochloride | DTXSID60469472 | MFCD08705298 | CS-0328164 | ADENOSINE5-DIPHOSPHATEMONOPOTASSIUMSALT | SCHEMBL1703901 | T70697 | CBA13046 | methylamino benzoate;hydrochloride | O-Benzoyl-N-methylhydroxylamine Hydrochloride | |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
| Product Description |
It is Benzoylation Reagents Simple Tools for a-Oxygenation of Aldehydes and Ketones. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzoic acids and derivatives |
| Alternative Parents | Benzoyl derivatives Carboxylic acids and derivatives Organooxygen compounds Organonitrogen compounds Organic oxides Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzoic acid or derivatives - Benzoyl - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Hydrochloride - Organooxygen compound - Organonitrogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzoic acids and derivatives. These are organic compounds containing a carboxylic acid substituent attached to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488197622 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488197622 |
| IUPAC Name | methylamino benzoate;hydrochloride |
| INCHI | InChI=1S/C8H9NO2.ClH/c1-9-11-8(10)7-5-3-2-4-6-7;/h2-6,9H,1H3;1H |
| InChIKey | FTCDQNQIGUCFSA-UHFFFAOYSA-N |
| Smiles | CNOC(=O)C1=CC=CC=C1.Cl |
| Isomeric SMILES | CNOC(=O)C1=CC=CC=C1.Cl |
| WGK Germany | 3 |
| Molecular Weight | 187.62 |
| Reaxy-Rn | 4560506 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=4560506&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Dec 16, 2024 | O159914 | |
| Certificate of Analysis | Nov 20, 2024 | O159914 | |
| Certificate of Analysis | Mar 12, 2024 | O159914 | |
| Certificate of Analysis | Mar 08, 2024 | O159914 | |
| Certificate of Analysis | Apr 17, 2023 | O159914 |
| Melt Point(°C) | 136°C(lit.) |
|---|---|
| Molecular Weight | 187.620 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 187.04 Da |
| Monoisotopic Mass | 187.04 Da |
| Topological Polar Surface Area | 38.300 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 130.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |