Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N349303-2.5mg
|
2.5mg |
2
|
$213.90
|
|
| Synonyms | CHEBI:145118 | 1-(~2~H_3_)Methyl-6-oxo-1,6-dihydropyridine-3-carboxamide | 6-Oxo-1-(trideuteriomethyl)pyridine-3-carboxamide | Nudifloramide-d3 | 1-(methyl-d3)-2-pyridoxone-5-carboxamide | DTXSID70858232 | 1207384-48-2 | Met-2Pyr-d3 | CS-0200751 | d3 Me-2 |
|---|---|
| Specifications & Purity | ≥95 atom% D,≥95% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Pyridinecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Pyridinecarboxamides |
| Direct Parent | Nicotinamides |
| Alternative Parents | Pyridinones Dihydropyridines Vinylogous amides Heteroaromatic compounds Primary carboxylic acid amides Lactams Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Nicotinamide - Dihydropyridine - Pyridinone - Hydropyridine - Vinylogous amide - Heteroaromatic compound - Primary carboxylic acid amide - Lactam - Carboxamide group - Carboxylic acid derivative - Azacycle - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as nicotinamides. These are heterocyclic aromatic compounds containing a pyridine ring substituted at position 3 by a carboxamide group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504772225 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504772225 |
| IUPAC Name | 6-oxo-1-(trideuteriomethyl)pyridine-3-carboxamide |
| INCHI | InChI=1S/C7H8N2O2/c1-9-4-5(7(8)11)2-3-6(9)10/h2-4H,1H3,(H2,8,11)/i1D3 |
| InChIKey | JLQSXXWTCJPCBC-FIBGUPNXSA-N |
| Smiles | CN1C=C(C=CC1=O)C(=O)N |
| Isomeric SMILES | [2H]C([2H])([2H])N1C=C(C=CC1=O)C(=O)N |
| Molecular Weight | 155.17 |
| Reaxy-Rn | 124385 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=124385&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Apr 08, 2023 | N349303 |
| Solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) |
|---|---|
| Melt Point(°C) | 200-205° C (dec.) |
| Molecular Weight | 155.170 g/mol |
| XLogP3 | -1.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 155.077 Da |
| Monoisotopic Mass | 155.077 Da |
| Topological Polar Surface Area | 63.400 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 266.000 |
| Isotope Atom Count | 3 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |