Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N468627-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$279.90
|
|
| Synonyms | N N-DIMETHYLBENZOTRIAZOLEMETHANAMINE | 1-(benzotriazol-1-yl)-N,N-dimethylmethanamine | AKOS024386618 | 1210522-68-1 | Benzotriazol-1-ylmethyl-dimethyl-amine | ST51038417 | 1-(1H-Benzo[d][1,2,3]triazol-1-yl)-N,N-dimethylmethanamine | SCHEMBL283984 | N,N-di |
|---|---|
| Specifications & Purity | ≥97% |
| Product Description |
Description Reactant for:Baylis-Hillman reactionCycloaddiion reactionsAminoalkylation of cyclic and acyclic alkyl vinyl ethersThermolysis in aqueous formic acid |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Benzotriazoles |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzotriazoles |
| Alternative Parents | Benzenoids Triazoles Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Benzotriazole - Benzenoid - Heteroaromatic compound - 1,2,3-triazole - Triazole - Azole - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzotriazoles. These are organic compounds containing a benzene fused to a triazole ring (a five-membered ring with two carbon atoms and three nitrogen atoms). |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-(benzotriazol-1-yl)-N,N-dimethylmethanamine |
|---|---|
| INCHI | InChI=1S/C9H12N4/c1-12(2)7-13-9-6-4-3-5-8(9)10-11-13/h3-6H,7H2,1-2H3 |
| InChIKey | QABYBLFTBSCYHR-UHFFFAOYSA-N |
| Smiles | CN(C)CN1C2=CC=CC=C2N=N1 |
| Isomeric SMILES | CN(C)CN1C2=CC=CC=C2N=N1 |
| WGK Germany | 3 |
| Molecular Weight | 176.22 |
| Reaxy-Rn | 162131 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=162131&ln= |
| Molecular Weight | 176.220 g/mol |
|---|---|
| XLogP3 | 1.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 176.106 Da |
| Monoisotopic Mass | 176.106 Da |
| Topological Polar Surface Area | 34.000 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 171.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |