Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N194175-250mg
|
250mg |
2
|
$15.90
|
|
|
N194175-1g
|
1g |
2
|
$39.90
|
|
|
N194175-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$142.90
|
|
|
N194175-25g
|
25g |
1
|
$492.90
|
|
| Synonyms | NN-Dimethyl-2-nitroaniline | BRN 0909276 | InChI=1/C8H10N2O2/c1-9(2)7-5-3-4-6-8(7)10(11)12/h3-6H,1-2H3 | 2-Nitro-NN-dimethylaniline | EINECS 210-210-6 | PS-4405 | DS-2474 | F1911-3584 | AKOS006228944 | DTXSID9060578 | AM101016 | MFCD00043602 | NPZDNLCYFLD |
|---|---|
| Specifications & Purity | ≥95% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Nitrobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Nitrobenzenes |
| Alternative Parents | Nitroaromatic compounds Dialkylarylamines Aniline and substituted anilines Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Organopnictogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Nitrobenzene - Nitroaromatic compound - Tertiary aliphatic/aromatic amine - Aniline or substituted anilines - Dialkylarylamine - C-nitro compound - Tertiary amine - Organic nitro compound - Organic oxoazanium - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Allyl-type 1,3-dipolar organic compound - Amine - Hydrocarbon derivative - Organic oxide - Organonitrogen compound - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitrobenzenes. These are compounds containing a nitrobenzene moiety, which consists of a benzene ring with a carbon bearing a nitro group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | N,N-dimethyl-2-nitroaniline |
|---|---|
| INCHI | InChI=1S/C8H10N2O2/c1-9(2)7-5-3-4-6-8(7)10(11)12/h3-6H,1-2H3 |
| InChIKey | NPZDNLCYFLDJFA-UHFFFAOYSA-N |
| Smiles | CN(C)C1=CC=CC=C1[N+](=O)[O-] |
| Isomeric SMILES | CN(C)C1=CC=CC=C1[N+](=O)[O-] |
| Molecular Weight | 166.18 |
| Reaxy-Rn | 909276 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=909276&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jun 07, 2024 | N194175 | |
| Certificate of Analysis | Jun 07, 2024 | N194175 | |
| Certificate of Analysis | Jun 07, 2024 | N194175 | |
| Certificate of Analysis | Jun 07, 2024 | N194175 | |
| Certificate of Analysis | Jun 07, 2024 | N194175 | |
| Certificate of Analysis | Jun 07, 2024 | N194175 | |
| Certificate of Analysis | Jun 07, 2024 | N194175 | |
| Certificate of Analysis | Jun 07, 2024 | N194175 |
| Molecular Weight | 166.180 g/mol |
|---|---|
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 166.074 Da |
| Monoisotopic Mass | 166.074 Da |
| Topological Polar Surface Area | 49.100 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 165.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |