Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
Basic Description
| Synonyms | 3-Methyl-N,N-diethylbenzenamine | meta-Methyl(diethylamino)benzene | AKOS009031464 | N,N-Diethyl-m-toluidine, >=99.0% (GC) | Z104478590 | m-Toluidine, N,N-diethyl- | AI3-28462 | 3-(Diethylamino)toluene | D3868 | DTXCID5031183 | EINECS 202-089-3 | SCHEMBL4 |
|---|---|
| Specifications & Purity | ≥99%(GC) |
| Storage Temp | Argon charged |
| Shipped In | Normal |
Taxonomic Classification
Taxonomy Tree
-
Kingdom
Organic compounds
-
Superclass
Benzenoids
-
Class
Benzene and substituted derivatives
- Subclass Toluenes
-
Class
Benzene and substituted derivatives
-
Superclass
Benzenoids
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Toluenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminotoluenes |
| Alternative Parents | Dialkylarylamines Aniline and substituted anilines Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Aminotoluene - Aniline or substituted anilines - Dialkylarylamine - Tertiary aliphatic/aromatic amine - Tertiary amine - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Amine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aminotoluenes. These are organic aromatic compounds containing a benzene that carries a single methyl group and one amino group. |
| External Descriptors | Not available |
|
|
|
Names and Identifiers
| Pubchem Sid | 488183829 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488183829 |
| IUPAC Name | N,N-diethyl-3-methylaniline |
| INCHI | InChI=1S/C11H17N/c1-4-12(5-2)11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3 |
| InChIKey | CIPVVROJHKLHJI-UHFFFAOYSA-N |
| Smiles | CCN(CC)C1=CC=CC(=C1)C |
| Isomeric SMILES | CCN(CC)C1=CC=CC(=C1)C |
| WGK Germany | 2 |
| RTECS | CX9869375 |
| Molecular Weight | 163.26 |
| Beilstein | 12(4)1816 |
| Reaxy-Rn | 878995 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=878995&ln= |
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
C of A & Other Certificates(BSE/TSE, COO):
Analytical Chart:
Chemical and Physical Properties
| Sensitivity | Air sensitive |
|---|---|
| Refractive Index | 1.54 |
| Flash Point(°F) | 212 °F |
| Flash Point(°C) | 100 °C |
| Boil Point(°C) | 107°C/11mmHg |
| Molecular Weight | 163.260 g/mol |
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 3 |
| Exact Mass | 163.136 Da |
| Monoisotopic Mass | 163.136 Da |
| Topological Polar Surface Area | 3.200 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 118.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Solution Calculators
Reviews
Customer Reviews
Remind me later